Spiramide
| Internal ID | f1c75822-6d8d-4a28-a623-c275d0709663 |
| Taxonomy | Organoheterocyclic compounds > Azaspirodecane derivatives |
| IUPAC Name | 8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES (Canonical) | C1CN(CCC12C(=O)NCN2C3=CC=CC=C3)CCCOC4=CC=C(C=C4)F |
| SMILES (Isomeric) | C1CN(CCC12C(=O)NCN2C3=CC=CC=C3)CCCOC4=CC=C(C=C4)F |
| InChI | InChI=1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) |
| InChI Key | FJUKDAZEABGEIH-UHFFFAOYSA-N |
| Popularity | 22 references in papers |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20090524 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 3.40 |
| AMI-193 |
| 510-74-7 |
| Espiramida |
| Spiramidum |
| Fluroxyspiramine |
| Spiramide [INN] |
| 8-[3-(4-Fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| R 5808 |
| R-5808 |
| CHEMBL79834 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.17% | 96.09% |
| CHEMBL228 | P31645 | Serotonin transporter | 96.58% | 95.51% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.66% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.60% | 98.95% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 95.39% | 92.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.20% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.46% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.01% | 91.11% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 92.71% | 97.53% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.25% | 90.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.26% | 98.59% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.05% | 90.71% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.46% | 100.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.31% | 94.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.53% | 94.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.59% | 95.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.39% | 91.03% |
| CHEMBL238 | Q01959 | Dopamine transporter | 84.83% | 95.88% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.66% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.24% | 95.89% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.87% | 95.83% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.34% | 93.04% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.93% | 91.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.49% | 93.99% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.96% | 90.17% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.49% | 90.95% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.31% | 94.66% |
| CHEMBL4531 | P17931 | Galectin-3 | 80.08% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spiraea japonica |
| PubChem | 68186 |
| LOTUS | LTS0194526 |
| wikiData | Q7577785 |