Sodium Benzoate
| Internal ID | 70721c08-c3d7-4484-b494-2d1e092ab429 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzoic acids |
| IUPAC Name | sodium benzoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
| InChI Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Popularity | 5,462 references in papers |
| Molecular Formula | C7H5NaO2 |
| Molecular Weight | 144.10 g/mol |
| Exact Mass | 144.01872368 g/mol |
| Topological Polar Surface Area (TPSA) | 40.10 Ų |
| XlogP | 0.00 |
| 532-32-1 |
| Sobenate |
| Antimol |
| Benzoic acid, sodium salt |
| sodium;benzoate |
| Benzoate sodium |
| Benzoate of soda |
| Benzoate, sodium |
| Natrium benzoicum |
| FEMA No. 3025 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL205 | P00918 | Carbonic anhydrase II |
30000 nM 30000 nM |
Ki Ki |
PMID: 15664815
PMID: 19297172 |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.10% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.40% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.36% | 83.82% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.45% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Paeonia rockii |
| Piper sarmentosum |
| Rhododendron ferrugineum |
| PubChem | 517055 |
| NPASS | NPC318107 |
| ChEMBL | CHEMBL1356 |