smeathxanthone A
Internal ID | af22706c-7148-49cb-9f31-45450a9c5278 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,8-tetrahydroxyxanthen-9-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C2=C(C=C1O)OC3=C(C=CC(=C3C2=O)O)O)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/CC1=C(C2=C(C=C1O)OC3=C(C=CC(=C3C2=O)O)O)O)/C)C |
InChI | InChI=1S/C23H24O6/c1-12(2)5-4-6-13(3)7-8-14-17(26)11-18-20(21(14)27)22(28)19-15(24)9-10-16(25)23(19)29-18/h5,7,9-11,24-27H,4,6,8H2,1-3H3/b13-7+ |
InChI Key | TWEXJIOSYZXWGT-NTUHNPAUSA-N |
Popularity | 6 references in papers |
Molecular Formula | C23H24O6 |
Molecular Weight | 396.40 g/mol |
Exact Mass | 396.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 5.90 |
CHEMBL480158 |
D0K6FM |
SCHEMBL24075576 |
BDBM50325675 |
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,8-tetrahydroxy-xanthen-9-one |
2-(3,7-Dimethylocta-2,6-dienyl)-1,3,5,8-tetrahydroxyxanthone |
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5,8-tetrahydroxyxanthen-9-one |
2-[3,7-Dimethylocta-2,6-dien-1-yl]-1,3,5,8-tetrahydroxy-9H-xanthen-9-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.79% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 95.64% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.88% | 89.34% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.45% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.93% | 89.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.41% | 92.08% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.70% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.38% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.30% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.40% | 86.33% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.84% | 98.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.75% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.45% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 82.38% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.12% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.95% | 99.15% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.84% | 85.30% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.59% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.01% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 11509473 |
NPASS | NPC68093 |
ChEMBL | CHEMBL480158 |
LOTUS | LTS0158279 |
wikiData | Q104399737 |