Smardaesidin A, (rel)-
Internal ID | ec90a0b3-411e-49a4-b30f-4a0479a0466c |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (1S,2R,4S,9R,10S,13R,14S,15S)-2,10-dihydroxy-14-(hydroxymethyl)-5,5,13-trimethyl-16-oxapentacyclo[7.6.2.01,10.04,9.013,15]heptadecane-3,17-dione |
SMILES (Canonical) | CC1(CCCC23C1C(=O)C(C4(C2(CCC5(C4C5CO)C)O)OC3=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@]3([C@@]45CCCC([C@@H]4C(=O)[C@@H]([C@]3([C@H]1[C@@H]2CO)OC5=O)O)(C)C)O |
InChI | InChI=1S/C20H28O6/c1-16(2)5-4-6-18-13(16)11(22)14(23)20(26-15(18)24)12-10(9-21)17(12,3)7-8-19(18,20)25/h10,12-14,21,23,25H,4-9H2,1-3H3/t10-,12-,13-,14-,17+,18-,19-,20-/m0/s1 |
InChI Key | GKARPIJLSMMCSR-ZSPSABHSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H28O6 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 0.80 |
Smardaesidin A |
CHEBI:69487 |
Q27137825 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.58% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 94.78% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.88% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.15% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.92% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.61% | 89.00% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 83.32% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.22% | 91.07% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.28% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.74% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.29% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.51% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ceratodon purpureus |
PubChem | 56599461 |
LOTUS | LTS0233352 |
wikiData | Q27137825 |