Sigmoidin E
Internal ID | 94a9b6e4-889b-45d4-9051-fa2e8c726855 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 3-prenylated flavans > 3-prenylated flavanones |
IUPAC Name | (2S)-2-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=CC(=CC2=C1OC(C=C2)(C)C)C3CC(=O)C4=C(C=C(C=C4O3)O)O)C |
SMILES (Isomeric) | CC(=CCC1=CC(=CC2=C1OC(C=C2)(C)C)[C@@H]3CC(=O)C4=C(C=C(C=C4O3)O)O)C |
InChI | InChI=1S/C25H26O5/c1-14(2)5-6-15-9-17(10-16-7-8-25(3,4)30-24(15)16)21-13-20(28)23-19(27)11-18(26)12-22(23)29-21/h5,7-12,21,26-27H,6,13H2,1-4H3/t21-/m0/s1 |
InChI Key | CKTMJKHXYHXNKU-NRFANRHFSA-N |
Popularity | 2 references in papers |
Molecular Formula | C25H26O5 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 5.60 |
116174-67-5 |
CHEMBL470655 |
Sigmoidin-E |
DTXSID50921953 |
BDBM50241819 |
(2S)-2-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
(2,6'-Bi-2H-1-benzopyran)-4(3H)-one, 5,7-dihydroxy-2',2'-dimethyl-8'-(3-methyl-2-butenyl)-, (S)- |
5,7-Dihydroxy-2',2'-dimethyl-8'-(3-methylbut-2-en-1-yl)-2,3-dihydro-2'H,4H-[2,6'-bi-1-benzopyran]-4-one |
![2D Structure of Sigmoidin E 2D Structure of Sigmoidin E](https://plantaedb.com/storage/docs/compounds/2023/07/sigmoidin-e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
39200 nM |
IC50 |
PMID: 17125223
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.27% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.19% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.42% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.35% | 96.12% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.11% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.51% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.12% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.36% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.40% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.59% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.60% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.92% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.66% | 83.82% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.04% | 95.71% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 84.00% | 80.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.72% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.40% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina abyssinica |
Erythrina mildbraedii |
Erythrina sigmoidea |
Maackia amurensis |
PubChem | 195173 |
NPASS | NPC111786 |
ChEMBL | CHEMBL470655 |
LOTUS | LTS0251012 |
wikiData | Q82895140 |