Shikonofuran C
Internal ID | 9017f864-d799-4cb5-815d-55474c97627c |
Taxonomy | Benzenoids > Phenols > Benzenediols > Hydroquinones |
IUPAC Name | [1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC(CC=C(C)C)C1=COC(=C1)C2=C(C=CC(=C2)O)O |
SMILES (Isomeric) | CC(C)CC(=O)OC(CC=C(C)C)C1=COC(=C1)C2=C(C=CC(=C2)O)O |
InChI | InChI=1S/C21H26O5/c1-13(2)5-8-19(26-21(24)9-14(3)4)15-10-20(25-12-15)17-11-16(22)6-7-18(17)23/h5-7,10-12,14,19,22-23H,8-9H2,1-4H3 |
InChI Key | RQSVDMLEQSPRMK-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H26O5 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 79.90 Ų |
XlogP | 4.90 |
CHEMBL1946217 |
BDBM50363752 |
85022-64-6 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.74% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.46% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.70% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.74% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.61% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.43% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.56% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.42% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.97% | 89.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.38% | 97.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.84% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.67% | 96.95% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.33% | 83.10% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.64% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 80.61% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.53% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arnebia euchroma |
Lithospermum erythrorhizon |
PubChem | 5321288 |
NPASS | NPC113428 |
ChEMBL | CHEMBL1946217 |
LOTUS | LTS0023311 |
wikiData | Q104395079 |