Sesamolinol 4'-O-b-D-glucosyl (1->6)-O-b-D-glucoside
Internal ID | 4a15a8a6-3688-4457-bc40-1d52b1848bc7 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[4-[[(3S,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]oxy]-2-methoxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)OC2C3COC(C3CO2)C4=CC5=C(C=C4)OCO5)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)O[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC5=C(C=C4)OCO5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O |
InChI | InChI=1S/C32H40O17/c1-40-19-7-14(46-30-16-10-41-29(15(16)9-42-30)13-2-4-17-20(6-13)45-12-44-17)3-5-18(19)47-32-28(39)26(37)24(35)22(49-32)11-43-31-27(38)25(36)23(34)21(8-33)48-31/h2-7,15-16,21-39H,8-12H2,1H3/t15-,16-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31+,32+/m0/s1 |
InChI Key | XTMLHNGHWHHERJ-FUPWJLLWSA-N |
Popularity | 3 references in papers |
Molecular Formula | C32H40O17 |
Molecular Weight | 696.60 g/mol |
Exact Mass | 696.22654980 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -1.20 |
Sesamolinol diglucoside |
CHEBI:190870 |
(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[4-[[(3S,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrouro[3,4-c]uran-6-yl]oxy]-2-methoxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.50% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.00% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.17% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.31% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.69% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.58% | 99.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.48% | 94.80% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.63% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.62% | 89.62% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.54% | 95.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.19% | 95.56% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.57% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 85.70% | 98.95% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.18% | 88.48% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.98% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.18% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.02% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.83% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.91% | 94.45% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.30% | 85.49% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.23% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.87% | 94.73% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.88% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sesamum indicum |
PubChem | 131750843 |
LOTUS | LTS0100842 |
wikiData | Q76856652 |