Scoparin 2''-O-xyloside
Internal ID | 944b281d-f1cc-4b05-99ce-884c633b9dd5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 8-[(2S,4S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)OC5C(C(C(CO5)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)[C@H]4C([C@H]([C@@H](C(O4)CO)O)O)O[C@H]5C([C@H]([C@@H](CO5)O)O)O)O |
InChI | InChI=1S/C27H30O15/c1-38-16-4-9(2-3-10(16)29)15-6-13(32)18-11(30)5-12(31)19(24(18)40-15)25-26(22(36)21(35)17(7-28)41-25)42-27-23(37)20(34)14(33)8-39-27/h2-6,14,17,20-23,25-31,33-37H,7-8H2,1H3/t14-,17?,20+,21-,22+,23?,25+,26?,27+/m1/s1 |
InChI Key | ZMXRYFUILUMXHH-HUIFHICCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.40 |
LMPK12110742 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.90% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.75% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.82% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.63% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.86% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.77% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.07% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.48% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.64% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.27% | 85.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.19% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.06% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.84% | 97.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.98% | 96.21% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.89% | 89.23% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.60% | 91.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.50% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.94% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.66% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.59% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.32% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.44% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Setaria italica |
PubChem | 44258158 |
LOTUS | LTS0109718 |
wikiData | Q105379808 |