Salvadoraside
Internal ID | 984d9ed4-e01d-4dac-8028-1a413f9d518a |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[4-[[5-[3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-4-(hydroxymethyl)oxolan-3-yl]methyl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)CC3COC(C3CO)C4=CC(=C(C(=C4)OC)OC5C(C(C(C(O5)CO)O)O)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)CC3COC(C3CO)C4=CC(=C(C(=C4)OC)OC5C(C(C(C(O5)CO)O)O)O)OC |
InChI | InChI=1S/C34H48O18/c1-44-18-6-14(7-19(45-2)31(18)51-33-28(42)26(40)24(38)22(11-36)49-33)5-16-13-48-30(17(16)10-35)15-8-20(46-3)32(21(9-15)47-4)52-34-29(43)27(41)25(39)23(12-37)50-34/h6-9,16-17,22-30,33-43H,5,10-13H2,1-4H3 |
InChI Key | JJHDIHQKWJEDDR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H48O18 |
Molecular Weight | 744.70 g/mol |
Exact Mass | 744.28406468 g/mol |
Topological Polar Surface Area (TPSA) | 265.00 Ų |
XlogP | -1.30 |
143522-30-9 |
D85084 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.56% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.85% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.67% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.57% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.61% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.37% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.97% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.44% | 96.61% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.64% | 85.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.27% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.31% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.84% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.63% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.84% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.85% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.80% | 95.89% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.35% | 89.44% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.53% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.50% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.22% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus senticosus |
Salvadora persica |
PubChem | 162343330 |
LOTUS | LTS0203144 |
wikiData | Q105129659 |