(R,R)-chrysanthemol
| Internal ID | ee6ce6ca-3a28-484b-bd1f-195cd22d92a0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Monocyclic monoterpenoids |
| IUPAC Name | [(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methanol |
| SMILES (Canonical) | CC(=CC1C(C1(C)C)CO)C |
| SMILES (Isomeric) | CC(=C[C@@H]1[C@H](C1(C)C)CO)C |
| InChI | InChI=1S/C10H18O/c1-7(2)5-8-9(6-11)10(8,3)4/h5,8-9,11H,6H2,1-4H3/t8-,9-/m1/s1 |
| InChI Key | HIPIENNKVJCMAP-RKDXNWHRSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.135765193 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 2.50 |
| (1R,3R)-Chrysanthemol |
| JU6FV4QD33 |
| Chrysanthemol, (1R,3R)- |
| 1R,3R-Chrysanthemyl alcohol |
| trans-(+)-Chrysanthemyl alcohol |
| UNII-JU6FV4QD33 |
| 32989-74-5 |
| Cyclopropanemethanol, 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-, (1R,3R)- |
| Cyclopropanemethanol, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1R-trans)- |
| SCHEMBL10992837 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.27% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.16% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.09% | 91.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.44% | 97.79% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.61% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.71% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.49% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia cana subsp. viscidula |
| Artemisia tridentata |
| Tanacetum parthenium |
| PubChem | 2724508 |
| LOTUS | LTS0029645 |
| wikiData | Q74417774 |