Roseadine
Internal ID | 47111b1f-2f64-4806-91ac-c9ca4b07ad27 |
Taxonomy | Alkaloids and derivatives > Plumeran-type alkaloids |
IUPAC Name | methyl (1R,10S,11R,12R)-11-acetyloxy-12-ethyl-4-[(Z)-1-[(1S,15R,16R)-16-ethyl-16-hydroxy-3,13-diazatetracyclo[11.2.2.02,10.04,9]heptadeca-2(10),4,6,8-tetraen-15-yl]-3-methoxy-3-oxoprop-1-en-2-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraene-10-carboxylate |
SMILES (Canonical) | CCC1(CN2CCC3=C(C1C(C2)C=C(C4=CC5=C(C=C4OC)N(C6C57CCN8C7C(C=CC8)(C(C6(C(=O)OC)O)OC(=O)C)CC)C)C(=O)OC)NC9=CC=CC=C39)O |
SMILES (Isomeric) | CC[C@@]1(CN2CCC3=C([C@@H]1[C@H](C2)/C=C(/C4=CC5=C(C=C4OC)N(C6[C@]57CCN8C7[C@@](C=CC8)([C@H]([C@@]6(C(=O)OC)O)OC(=O)C)CC)C)\C(=O)OC)NC9=CC=CC=C39)O |
InChI | InChI=1S/C46H56N4O9/c1-8-43-16-12-18-50-20-17-45(39(43)50)32-22-30(35(56-5)23-34(32)48(4)40(45)46(55,42(53)58-7)41(43)59-26(3)51)31(38(52)57-6)21-27-24-49-19-15-29-28-13-10-11-14-33(28)47-37(29)36(27)44(54,9-2)25-49/h10-14,16,21-23,27,36,39-41,47,54-55H,8-9,15,17-20,24-25H2,1-7H3/b31-21-/t27-,36-,39?,40?,41+,43+,44-,45+,46-/m0/s1 |
InChI Key | JPJKITSCFHYWLR-IMQGIZBBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C46H56N4O9 |
Molecular Weight | 809.00 g/mol |
Exact Mass | 808.40472938 g/mol |
Topological Polar Surface Area (TPSA) | 154.00 Ų |
XlogP | 3.50 |
NSC 304424 |
CHEMBL505476 |
Aspidospermidine-3-carboxylic acid, 4-(acetyloxyl)-6,7-didehydro-15-(2-(12-ethyl-1,2,4,5,6,7-hexahydro-12-hydroxy-3,6-ethano-3H-azocino(5,4-b)indol-5-yl)-1-(methoxycarbonyl)ethenyl)-3-hydroxy-16-methoxy-1-methyl-, methyl ester, (2beta,3beta,4beta,5alpha,12beta,15(3R,5R,6R,12R),19alpha)- |
![2D Structure of Roseadine 2D Structure of Roseadine](https://plantaedb.com/storage/docs/compounds/2023/11/roseadine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.59% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.98% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.45% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.97% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 95.47% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.90% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.09% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.75% | 93.99% |
CHEMBL5747 | Q92793 | CREB-binding protein | 88.86% | 95.12% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.43% | 95.17% |
CHEMBL5028 | O14672 | ADAM10 | 88.38% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.10% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.70% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.48% | 89.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.19% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.80% | 97.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.00% | 95.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.95% | 90.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.84% | 97.93% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.54% | 92.62% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.90% | 97.50% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.39% | 85.83% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.84% | 92.98% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.58% | 91.19% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.61% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
Plectranthus grandidentatus |
Plectranthus sanguineus |
PubChem | 44559285 |
LOTUS | LTS0110830 |
wikiData | Q105344507 |