Rocaglamide I
Internal ID | d65a7390-a580-41c8-8843-9d426c27f511 |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Flavaglines |
IUPAC Name | [(1R,2R,3S,3aR,8bS)-2-(dimethylcarbamoyl)-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C(C(C2(C1(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5)C(=O)N(C)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@@H]([C@H]([C@]2([C@@]1(C3=C(O2)C=C(C=C3OC)OC)O)C4=CC(=C(C=C4)OC)O)C5=CC=CC=C5)C(=O)N(C)C |
InChI | InChI=1S/C31H33NO9/c1-17(33)40-28-25(29(35)32(2)3)26(18-10-8-7-9-11-18)31(19-12-13-22(38-5)21(34)14-19)30(28,36)27-23(39-6)15-20(37-4)16-24(27)41-31/h7-16,25-26,28,34,36H,1-6H3/t25-,26-,28-,30+,31+/m1/s1 |
InChI Key | MIDNNAQHKCLBSH-ZTLBFRGQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H33NO9 |
Molecular Weight | 563.60 g/mol |
Exact Mass | 563.21553163 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 2.50 |
189322-68-7 |
[(1R,2R,3S,3aR,8bS)-2-(dimethylcarbamoyl)-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl] acetate |
1H-Cyclopenta[b]benzofuran-2-carboxamide, 1-(acetyloxy)-2,3,3a,8b-tetrahydro-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-, (1R,2R,3S,3aR,8bS)- |
C31H33NO9 |
DTXSID501099091 |
J-012215 |
(1R,2R,3S,3aR,8bS)-1-(Acetyloxy)-2,3,3a,8b-tetrahydro-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-N,N-dimethyl-3-phenyl-1H-cyclopenta[b]benzofuran-2-carboxamide |
(1R,2R,3S,3AR,8bS)-2-(dimethylcarbamoyl)-8b-hydroxy-3a-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-3-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-1-yl acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.89% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.35% | 95.56% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 93.70% | 89.44% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.12% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.34% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.87% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.50% | 97.14% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.95% | 90.20% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.72% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.27% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.05% | 99.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.65% | 94.08% |
CHEMBL2535 | P11166 | Glucose transporter | 84.01% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.64% | 89.00% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.23% | 85.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.07% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.75% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.67% | 92.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.12% | 93.99% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.09% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia odorata |
Physalis philadelphica |
Withania somnifera |
PubChem | 10626755 |
LOTUS | LTS0212191 |
wikiData | Q105191489 |