7,8-dimethyl-10-((2R,3R,4S)-2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4(3H,10H)-dione
Internal ID | 1731f478-55a5-48f5-befb-382813e6d168 |
Taxonomy | Organoheterocyclic compounds > Pteridines and derivatives > Alloxazines and isoalloxazines > Flavins |
IUPAC Name | 7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
SMILES (Canonical) | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(CO)O)O)O |
SMILES (Isomeric) | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@H]([C@H]([C@H](CO)O)O)O |
InChI | InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m1/s1 |
InChI Key | AUNGANRZJHBGPY-MBNYWOFBSA-N |
Popularity | 132 references in papers |
Molecular Formula | C17H20N4O6 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.13828437 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -1.50 |
Atomic LogP (AlogP) | -1.72 |
H-Bond Acceptor | 9 |
H-Bond Donor | 5 |
Rotatable Bonds | 5 |
Hyflavin |
SR-05000001670 |
C17-H20-N4-O6 |
CAS-83-88-5 |
Riboflavin, USP grade |
Spectrum2_000660 |
SCHEMBL7707 |
BSPBio_002264 |
SPECTRUM1505347 |
SPBio_000699 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 7,8-dimethyl-10-((2R,3R,4S)-2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4(3H,10H)-dione 2D Structure of 7,8-dimethyl-10-((2R,3R,4S)-2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4(3H,10H)-dione](https://plantaedb.com/storage/docs/compounds/2023/07/riboflavin-b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9609 | 96.09% |
Caco-2 | - | 0.8020 | 80.20% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.3960 | 39.60% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | + | 0.5593 | 55.93% |
P-glycoprotein inhibitior | - | 0.7935 | 79.35% |
P-glycoprotein substrate | - | 0.7126 | 71.26% |
CYP3A4 substrate | + | 0.5190 | 51.90% |
CYP2C9 substrate | - | 0.8062 | 80.62% |
CYP2D6 substrate | - | 0.8793 | 87.93% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | + | 0.7302 | 73.02% |
CYP2D6 inhibition | - | 0.9516 | 95.16% |
CYP1A2 inhibition | + | 0.8531 | 85.31% |
CYP2C8 inhibition | - | 0.8495 | 84.95% |
CYP inhibitory promiscuity | - | 0.9203 | 92.03% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.7700 | 77.00% |
Carcinogenicity (trinary) | Non-required | 0.6445 | 64.45% |
Eye corrosion | - | 0.9892 | 98.92% |
Eye irritation | - | 0.9840 | 98.40% |
Skin irritation | - | 0.7892 | 78.92% |
Skin corrosion | - | 0.9477 | 94.77% |
Ames mutagenesis | - | 0.8200 | 82.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5444 | 54.44% |
Micronuclear | + | 0.9300 | 93.00% |
Hepatotoxicity | - | 0.9676 | 96.76% |
skin sensitisation | - | 0.8829 | 88.29% |
Respiratory toxicity | + | 0.6222 | 62.22% |
Reproductive toxicity | + | 0.9111 | 91.11% |
Mitochondrial toxicity | + | 0.8625 | 86.25% |
Nephrotoxicity | - | 0.8449 | 84.49% |
Acute Oral Toxicity (c) | IV | 0.6176 | 61.76% |
Estrogen receptor binding | + | 0.6157 | 61.57% |
Androgen receptor binding | + | 0.6159 | 61.59% |
Thyroid receptor binding | - | 0.6155 | 61.55% |
Glucocorticoid receptor binding | + | 0.6460 | 64.60% |
Aromatase binding | + | 0.6293 | 62.93% |
PPAR gamma | + | 0.6031 | 60.31% |
Honey bee toxicity | - | 0.9577 | 95.77% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.7700 | 77.00% |
Fish aquatic toxicity | - | 0.8580 | 85.80% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL5990 | P38398 | Breast cancer type 1 susceptibility protein |
3981.1 nM |
Potency |
via CMAUP
|
CHEMBL4801 | P29466 | Caspase-1 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL3468 | P55210 | Caspase-7 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
7943.28 nM |
AC50 |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
12589.3 nM 6309.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
12589.3 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
7079.5 nM |
Potency |
via CMAUP
|
CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
10000 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.55% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.02% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.61% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.52% | 96.09% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.53% | 93.10% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.28% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.44% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.66% | 93.99% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.15% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.56% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.93% | 86.92% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.59% | 90.08% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.68% | 92.68% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.19% | 93.40% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 81.99% | 97.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.96% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.46% | 90.71% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.38% | 93.65% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.37% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 6759 |
NPASS | NPC172937 |
ChEMBL | CHEMBL1397833 |
LOTUS | LTS0142375 |
wikiData | Q27167158 |