Rhodexin B
Internal ID | 3c954059-7abe-4b5e-81be-f6a930dce841 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | 3-(3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl)-2H-furan-5-one |
SMILES (Canonical) | CC12CCC(CC1CCC3C2CCC4(C3(CC=C4C5=CC(=O)OC5)O)C)O |
SMILES (Isomeric) | CC12CCC(CC1CCC3C2CCC4(C3(CC=C4C5=CC(=O)OC5)O)C)O |
InChI | InChI=1S/C23H32O4/c1-21-8-5-16(24)12-15(21)3-4-19-18(21)6-9-22(2)17(7-10-23(19,22)26)14-11-20(25)27-13-14/h7,11,15-16,18-19,24,26H,3-6,8-10,12-13H2,1-2H3 |
InChI Key | YGABECOLNBBTLH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H32O4 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.90 |
3,14-dihydroxycarda-16,20(22)-dienolide |
Rhodexin |
3-(3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-17-yl)-2H-furan-5-one |
RHODEXIN B |
NSC-160845 |
NSC160845 |
DTXSID20950290 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.48% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.44% | 97.25% |
CHEMBL1871 | P10275 | Androgen Receptor | 92.38% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.48% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.18% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.06% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.76% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.12% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.51% | 95.93% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.87% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.26% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.76% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.80% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 81.50% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.91% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dipcadi glaucum |
Ornithogalum arcuatum |
Rohdea japonica |
PubChem | 293736 |
LOTUS | LTS0184708 |
wikiData | Q105347928 |