Rhazidine
| Internal ID | d2517b43-2741-45f3-8806-0e8b074245bb |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyrroloindoles |
| IUPAC Name | 15-ethyl-11-aza-1-azoniapentacyclo[13.3.1.01,12.04,12.05,10]nonadeca-5,7,9-trien-4-ol |
| SMILES (Canonical) | CCC12CCC[N+]3(C1)CCC4(C3(CC2)NC5=CC=CC=C54)O |
| SMILES (Isomeric) | CCC12CCC[N+]3(C1)CCC4(C3(CC2)NC5=CC=CC=C54)O |
| InChI | InChI=1S/C19H27N2O/c1-2-17-8-5-12-21(14-17)13-11-18(22)15-6-3-4-7-16(15)20-19(18,21)10-9-17/h3-4,6-7,20,22H,2,5,8-14H2,1H3/q+1 |
| InChI Key | YMRLYQGSGLAWTN-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H27N2O+ |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.212338489 g/mol |
| Topological Polar Surface Area (TPSA) | 32.30 Ų |
| XlogP | 2.80 |
| 15381-61-0 |
| 3,7-Methanoazocino(1',2':1,2)pyrrolo(2,3-b)indol-7-ium, 3-ethyl-1,2,3,4,5,6,8,9,9a,14-decahydro-9a-hydroxy- |
| DTXSID80934839 |
| 3-Ethyl-9a-hydroxy-1,2,3,4,5,6,8,9,9a,14-decahydro-3,7-methanoazocino[1',2':1,2]pyrrolo[2,3-b]indol-7-ium |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.20% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.00% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.17% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.01% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.05% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.90% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.14% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.61% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.24% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aspidosperma quebracho-blanco |
| Melodinus fusiformis |
| PubChem | 3084227 |
| LOTUS | LTS0224543 |
| wikiData | Q82910805 |