resveratrol-4'-O-beta-d-glucopyranoside
Internal ID | c918b807-c0a5-4e5e-840c-26d5d0f3e76e |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-5-3-11(4-6-15)1-2-12-7-13(22)9-14(23)8-12/h1-9,16-26H,10H2/t16-,17-,18+,19-,20-/m1/s1 |
InChI Key | RUOKEYJFAJITAG-OUUBHVDSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H22O8 |
Molecular Weight | 390.40 g/mol |
Exact Mass | 390.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.61% | 95.93% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.71% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 91.77% | 90.71% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.11% | 83.57% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.94% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.92% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.76% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.65% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.66% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.39% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.27% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.31% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.83% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.87% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.20% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum officinale |
PubChem | 54286634 |
LOTUS | LTS0258713 |
wikiData | Q104394010 |