reissantin E
Internal ID | fc0ac188-29ba-430f-a3fc-32362b57041a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Agarofurans |
IUPAC Name | [(1S,2S,5S,6S,7R,8S,9S,12R)-5,8-diacetyloxy-2,12-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
SMILES (Canonical) | CC(=O)OC1CCC(C23C1(C(C(C(C2O)C(O3)(C)C)OC(=O)C)OC(=O)C4=CC=CC=C4)C)(C)O |
SMILES (Isomeric) | CC(=O)O[C@H]1CC[C@]([C@]23[C@@]1([C@H]([C@H]([C@H]([C@H]2O)C(O3)(C)C)OC(=O)C)OC(=O)C4=CC=CC=C4)C)(C)O |
InChI | InChI=1S/C26H34O9/c1-14(27)32-17-12-13-24(5,31)26-20(29)18(23(3,4)35-26)19(33-15(2)28)21(25(17,26)6)34-22(30)16-10-8-7-9-11-16/h7-11,17-21,29,31H,12-13H2,1-6H3/t17-,18+,19-,20+,21-,24-,25-,26-/m0/s1 |
InChI Key | VDMRSWTYKXKIDN-SWHFUDTGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H34O9 |
Molecular Weight | 490.50 g/mol |
Exact Mass | 490.22028266 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 2.00 |
CHEMBL467201 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.54% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.43% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.26% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.77% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.63% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.64% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.42% | 90.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.64% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 86.54% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.46% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.49% | 91.19% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.67% | 83.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.19% | 85.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.94% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.65% | 89.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.86% | 81.11% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.51% | 92.62% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.46% | 89.44% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.10% | 100.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.98% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Reissantia buchananii |
PubChem | 10323282 |
LOTUS | LTS0098828 |
wikiData | Q105284256 |