Ramonanin A, (rel)-
Internal ID | 42644128-f2a4-4392-bcc1-e2649290cde1 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 2-methoxy-4-[(1R,2'R,3S,5'S,6R)-1,3,5'-tris(4-hydroxy-3-methoxyphenyl)-3'-methylidenespiro[3,4,5,7-tetrahydro-1H-2-benzofuran-6,4'-oxolane]-2'-yl]phenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2C(=C)C3(CCC4=C(C3)C(OC4C5=CC(=C(C=C5)O)OC)C6=CC(=C(C=C6)O)OC)C(O2)C7=CC(=C(C=C7)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H]2C(=C)[C@]3(CCC4=C(C3)[C@H](O[C@H]4C5=CC(=C(C=C5)O)OC)C6=CC(=C(C=C6)O)OC)[C@@H](O2)C7=CC(=C(C=C7)O)OC)O |
InChI | InChI=1S/C40H40O10/c1-21-36(22-6-10-28(41)32(16-22)45-2)50-39(25-9-13-31(44)35(19-25)48-5)40(21)15-14-26-27(20-40)38(24-8-12-30(43)34(18-24)47-4)49-37(26)23-7-11-29(42)33(17-23)46-3/h6-13,16-19,36-39,41-44H,1,14-15,20H2,2-5H3/t36-,37-,38+,39-,40+/m0/s1 |
InChI Key | GVLSMMAPMUCRRO-OQZGELFMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H40O10 |
Molecular Weight | 680.70 g/mol |
Exact Mass | 680.26214747 g/mol |
Topological Polar Surface Area (TPSA) | 136.00 Ų |
XlogP | 5.10 |
CHEBI:68065 |
Ramonanin A |
CHEMBL1782125 |
SCHEMBL15334802 |
Q27136558 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.32% | 96.09% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 92.36% | 88.48% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.19% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.43% | 92.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.22% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.45% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.69% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.64% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.47% | 93.40% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.63% | 99.15% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.96% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.03% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 80.61% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guaiacum officinale |
PubChem | 45275140 |
LOTUS | LTS0043007 |
wikiData | Q27136558 |