(R)-Methyl 2,3-dihydroxypropanoate
| Internal ID | c776e39f-f85e-43da-8e75-c44b94036ca6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Sugar acids and derivatives |
| IUPAC Name | methyl (2R)-2,3-dihydroxypropanoate |
| SMILES (Canonical) | COC(=O)C(CO)O |
| SMILES (Isomeric) | COC(=O)[C@@H](CO)O |
| InChI | InChI=1S/C4H8O4/c1-8-4(7)3(6)2-5/h3,5-6H,2H2,1H3/t3-/m1/s1 |
| InChI Key | COFCNNXZXGCREM-GSVOUGTGSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | -1.20 |
| 18289-89-9 |
| Propanoic acid, 2,3-dihydroxy-, methyl ester, (2R)- |
| METHYL (2R)-2,3-DIHYDROXYPROPANOATE |
| Methyl (R)-2,3-dihydroxypropanoate |
| 82142-72-1 |
| MFCD06204263 |
| (R)-methyl glycerate |
| (r)-glyceric acid methyl ester |
| SCHEMBL10535243 |
| COFCNNXZXGCREM-GSVOUGTGSA-N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.48% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.58% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.77% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.19% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.91% | 94.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.89% | 83.82% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.47% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.20% | 94.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.24% | 97.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.19% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Broussonetia papyrifera |
| PubChem | 9920382 |
| LOTUS | LTS0119198 |
| wikiData | Q104966831 |