(R)-Dimethyl 2-hydroxysuccinate
| Internal ID | 23d3a4d1-9a5e-495d-93ac-d52e92dc2a5a |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Beta hydroxy acids and derivatives |
| IUPAC Name | dimethyl (2R)-2-hydroxybutanedioate |
| SMILES (Canonical) | COC(=O)CC(C(=O)OC)O |
| SMILES (Isomeric) | COC(=O)C[C@H](C(=O)OC)O |
| InChI | InChI=1S/C6H10O5/c1-10-5(8)3-4(7)6(9)11-2/h4,7H,3H2,1-2H3/t4-/m1/s1 |
| InChI Key | YSEKNCXYRGKTBJ-SCSAIBSYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | -0.70 |
| (R)-Dimethyl 2-hydroxysuccinate |
| D-(+)-Malic Acid Dimethyl Ester |
| dimethyl (2R)-2-hydroxybutanedioate |
| Dimethyl (R)-(+)-malate |
| Butanedioic acid, hydroxy-, dimethyl ester, (2R)- |
| 1,4-Dimethyl (2R)-2-Hydroxybutanedioate |
| Dimethyl D-malate |
| L-(-)-Apple Acid Dimethyl Ester |
| dimethyl (r)-malate |
| (+)-Dimethyl malate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.45% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.07% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.40% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.73% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.94% | 94.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.38% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.06% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.70% | 98.95% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.38% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.60% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Homalomena occulta |
| Myrciaria dubia |
| Oxalis pes-caprae |
| PubChem | 11062697 |
| NPASS | NPC135697 |
| LOTUS | LTS0232691 |
| wikiData | Q72470822 |