Quercetin 3-beta-laminaribioside
Internal ID | a994cea3-8318-4f25-9aea-52cfdc6660d7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[3,5-dihydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O17/c28-6-14-17(34)20(37)21(38)26(41-14)43-24-18(35)15(7-29)42-27(22(24)39)44-25-19(36)16-12(33)4-9(30)5-13(16)40-23(25)8-1-2-10(31)11(32)3-8/h1-5,14-15,17-18,20-22,24,26-35,37-39H,6-7H2 |
InChI Key | RAMYMBNTEMMDSX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O17 |
Molecular Weight | 626.50 g/mol |
Exact Mass | 626.14829948 g/mol |
Topological Polar Surface Area (TPSA) | 286.00 Ų |
XlogP | -1.20 |
Quercetin 3-b-laminaribioside |
CHEBI:177937 |
3-[3,5-dihydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.86% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.28% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 94.40% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.36% | 86.33% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.02% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.90% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.89% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.95% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.42% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 87.96% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.35% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.84% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.94% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.98% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mangifera indica |
Pteridium aquilinum |
PubChem | 74978161 |
LOTUS | LTS0079088 |
wikiData | Q105232720 |