Pyrano[2,3-b]carbazol-8-ol, 2,10-dihydro-2,2,7-trimethyl-
| Internal ID | 37844513-aa08-457f-b372-a423e1969063 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 2,2,7-trimethyl-10H-pyrano[2,3-b]carbazol-8-ol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)NC3=C2C=C4C=CC(OC4=C3)(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)NC3=C2C=C4C=CC(OC4=C3)(C)C |
| InChI | InChI=1S/C18H17NO2/c1-10-6-12-13-7-11-4-5-18(2,3)21-17(11)9-15(13)19-14(12)8-16(10)20/h4-9,19-20H,1-3H3 |
| InChI Key | RUQHCCGMEXXSBD-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 4.30 |
| Pyrano[2,3-b]carbazol-8-ol, 2,10-dihydro-2,2,7-trimethyl- |
| NSC654283 |
| CHEMBL495872 |
| SCHEMBL30929789 |
| DTXSID30327414 |
| NSC-654283 |
| NCI60_018847 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.63% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.13% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.06% | 91.49% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.67% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.41% | 92.94% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.89% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.87% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.69% | 90.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.19% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.22% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.99% | 91.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.16% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.10% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.83% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.30% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera euchrestifolia |
| PubChem | 375149 |
| NPASS | NPC291535 |
| ChEMBL | CHEMBL495872 |
| LOTUS | LTS0265583 |
| wikiData | Q82089207 |