Pterosin F
| Internal ID | 6e13e26c-17c0-4d42-ab9d-fc56fd6ea4c3 |
| Taxonomy | Benzenoids > Indanes > Indanones |
| IUPAC Name | 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
| SMILES (Canonical) | CC1CC2=C(C1=O)C(=C(C(=C2)C)CCCl)C |
| SMILES (Isomeric) | CC1CC2=C(C1=O)C(=C(C(=C2)C)CCCl)C |
| InChI | InChI=1S/C14H17ClO/c1-8-6-11-7-9(2)14(16)13(11)10(3)12(8)4-5-15/h6,9H,4-5,7H2,1-3H3 |
| InChI Key | DFJCTWMNTSWCRI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.73 g/mol |
| Exact Mass | 236.0967929 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 3.80 |
| 34175-98-9 |
| 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydro-1h-inden-1-one |
| HJ-5 |
| 1-Indanone, 6-(2-chloroethyl)-2,5,7-trimethyl-, (-)- |
| 1H-Inden-1-one, 6-(2-chloroethyl)-2,3-dihydro-2,5,7-trimethyl-, (R)- |
| DTXSID30955716 |
| CHEBI:169882 |
| 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
| 6-(2-Chloroethyl)-2,5,7-trimethyl-(-)-1-Indanone |
| 6-(2-Chloroethyl)-2,3-dihydro-2,5,7-trimethyl-1H-inden-1-one, 9CI |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.34% | 98.95% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 93.20% | 86.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.20% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.06% | 95.56% |
| CHEMBL240 | Q12809 | HERG | 89.59% | 89.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.06% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.51% | 90.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.55% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.40% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.06% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.05% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.59% | 94.00% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.70% | 81.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.63% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Microlepia strigosa |
| Pteridium aquilinum |
| Pteris cretica |
| PubChem | 134978 |
| LOTUS | LTS0090273 |
| wikiData | Q82935437 |