Propyl palmitate
| Internal ID | 85e1a7bb-5a87-4896-8561-8ba217d375b9 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
| IUPAC Name | propyl hexadecanoate |
| SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)OCCC |
| SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)OCCC |
| InChI | InChI=1S/C19H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)21-18-4-2/h3-18H2,1-2H3 |
| InChI Key | BEKZXQKGTDVSKX-UHFFFAOYSA-N |
| Popularity | 21 references in papers |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.287180451 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 8.30 |
| Propyl hexadecanoate |
| 2239-78-3 |
| Hexadecanoic acid, propyl ester |
| PALMITIC ACID PROPYL ESTER |
| Propyl palmitate # |
| EINECS 218-803-1 |
| AI3-31575 |
| hexadecanoic acid propyl ester |
| SCHEMBL424533 |
| DTXSID5073955 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.59% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.11% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.79% | 92.08% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.10% | 97.29% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.87% | 85.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.42% | 98.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.90% | 98.03% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.13% | 89.63% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.47% | 91.81% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.56% | 92.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.62% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.89% | 92.86% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.19% | 87.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.53% | 94.33% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.25% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Daphne odora |
| Malus domestica |
| Zea mays |
| PubChem | 75232 |
| LOTUS | LTS0019712 |
| wikiData | Q63392073 |