Proceraoside B
Internal ID | 80ad8062-84f2-4a9f-9cc2-296a830d2a71 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-3-[(2R,3R,4S,5S,6S)-5-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-3-[(2S,6S)-6-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-5-[(2Z,6S)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxy-6-methyloxan-2-yl]oxy-2,6-dimethyloct-7-enoyl]oxy-10-[(2R,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC(C)(CCCC(C)C(=O)OC2CC3(C(CC2(C)C)C4=CCC5C6(CCC(C(C6CCC5(C4(CC3O)C)C)(C)C)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)OC9C(C(C(CO9)O)O)O)O)O)O)C)C(=O)OC1C(C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)C)OC1C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)C=C)O)O)OC(=O)C(=CCCC(C)(C=C)O)C |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@](C)(CCC[C@H](C)C(=O)O[C@H]2C[C@@]3([C@@H](C[C@@]4(C(=CC[C@H]5[C@]4(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@H](CO8)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O)O)C)C)[C@@H]3CC2(C)C)C)O)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O[C@H]1[C@@H]([C@H]([C@@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)C=C)O)O)OC(=O)/C(=C\CC[C@@](C)(C=C)O)/C |
InChI | InChI=1S/C95H152O44/c1-16-90(11,121)26-18-20-40(4)78(119)133-72-41(5)126-84(70(116)65(72)111)139-91(12,17-2)27-19-21-39(3)77(118)131-55-32-95(87(120)138-86-76(64(110)59(105)48(34-97)129-86)137-83-71(117)74(135-82-69(115)62(108)58(104)47(33-96)127-82)73(42(6)125-83)134-81-67(113)60(106)49(35-98)128-81)44(30-88(55,7)8)43-22-23-52-92(13)28-25-54(89(9,10)51(92)24-29-93(52,14)94(43,15)31-53(95)101)132-80-68(114)63(109)61(107)50(130-80)38-124-85-75(57(103)46(100)37-123-85)136-79-66(112)56(102)45(99)36-122-79/h16-17,20,22,39,41-42,44-76,79-86,96-117,121H,1-2,18-19,21,23-38H2,3-15H3/b40-20-/t39-,41+,42-,44-,45+,46-,47+,48+,49-,50+,51-,52+,53+,54-,55-,56-,57-,58+,59+,60-,61+,62-,63-,64-,65+,66+,67+,68+,69+,70+,71+,72+,73-,74-,75+,76+,79-,80-,81-,82-,83+,84-,85-,86-,90+,91+,92-,93+,94+,95+/m0/s1 |
InChI Key | HQJDTNQUMAVTSG-QFONWNOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C95H152O44 |
Molecular Weight | 1998.20 g/mol |
Exact Mass | 1997.9690029 g/mol |
Topological Polar Surface Area (TPSA) | 683.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.71% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.33% | 97.25% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 96.82% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.09% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.38% | 96.47% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 92.72% | 95.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.23% | 94.73% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.96% | 96.90% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.56% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.49% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.47% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 90.26% | 97.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.29% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.16% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.02% | 93.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.43% | 97.29% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.89% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.55% | 95.93% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.43% | 96.43% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.14% | 98.75% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.96% | 93.18% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.82% | 99.17% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.96% | 85.31% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.30% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.20% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.78% | 92.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.76% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.50% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.40% | 89.67% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.05% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.04% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.96% | 94.45% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.57% | 92.98% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.47% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.36% | 97.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.06% | 92.94% |
CHEMBL4683 | Q12884 | Fibroblast activation protein alpha | 81.20% | 93.07% |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 80.95% | 95.44% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.83% | 90.08% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.62% | 97.47% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.32% | 95.71% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.16% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia procera |
PubChem | 162989413 |
LOTUS | LTS0107151 |
wikiData | Q105032268 |