Proanthocyanidin A5'
Internal ID | a082ce96-c74f-4965-93c0-ebc997efd900 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (1S,5R,6R,13R,21S)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC3=C2C4C(C(O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)C7=CC(=C(C=C7)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H](OC2=C1C(=CC3=C2[C@H]4[C@@H]([C@@](O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)C7=CC(=C(C=C7)O)O)O |
InChI | InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26+,27-,29+,30-/m1/s1 |
InChI Key | NSEWTSAADLNHNH-JXCVSLFXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H24O12 |
Molecular Weight | 576.50 g/mol |
Exact Mass | 576.12677620 g/mol |
Topological Polar Surface Area (TPSA) | 210.00 Ų |
XlogP | 2.40 |
(1S,5R,6R,13R,21S)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
111466-30-9 |
Procyanidin A5' |
SCHEMBL15399757 |
CHEBI:191732 |
(+)-Epicatechin-(2a-7)(4a-8)-epicatechin |
Ent-Epicatechin-(2a->7,4a->8)-epicatechin |
(1S,5R,6R,13R,21S)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.0^{2,11}.0^{3,8}.0^{15,20}]henicosa-2,8,10,15,17,19-hexaene-6,9,17,19,21-pentol |
![2D Structure of Proanthocyanidin A5' 2D Structure of Proanthocyanidin A5'](https://plantaedb.com/storage/docs/compounds/2023/11/proanthocyanidin-a5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1697671 | P49763 | Placenta growth factor |
394 nM |
Kd |
via Super-PRED
|
CHEMBL1783 | P15692 | Vascular endothelial growth factor A |
476 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.21% | 91.49% |
CHEMBL233 | P35372 | Mu opioid receptor | 94.99% | 97.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL236 | P41143 | Delta opioid receptor | 91.91% | 99.35% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.49% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.48% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.11% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.21% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.56% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.79% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.84% | 94.62% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.69% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus spinosa |
PubChem | 9938091 |
LOTUS | LTS0172976 |
wikiData | Q105184981 |