Primulic acid 2
Internal ID | 377e833b-8c7e-4f59-b95f-c563217728c2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 4-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-6-[(2-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl)oxy]oxane-2-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(C(OC(C3OC4C(C(C(C(O4)CO)OC5C(C(C(CO5)O)O)O)O)O)OC6CCC7(C(C6(C)C)CCC8(C7CCC91C8(CC(C2(C9CC(CC2)(C)C)CO1)O)C)C)C)C(=O)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3C(C(OC(C3OC4C(C(C(C(O4)CO)OC5C(C(C(CO5)O)O)O)O)O)OC6CCC7(C(C6(C)C)CCC8(C7CCC91C8(CC(C2(C9CC(CC2)(C)C)CO1)O)C)C)C)C(=O)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C59H96O27/c1-23-32(64)35(67)39(71)49(78-23)85-45-36(68)34(66)25(19-60)79-51(45)83-43-41(73)44(47(74)75)84-52(46(43)86-50-40(72)37(69)42(26(20-61)80-50)82-48-38(70)33(65)24(62)21-76-48)81-31-11-12-55(6)27(54(31,4)5)9-13-56(7)28(55)10-14-59-29-17-53(2,3)15-16-58(29,22-77-59)30(63)18-57(56,59)8/h23-46,48-52,60-73H,9-22H2,1-8H3,(H,74,75) |
InChI Key | PDCAFVYIKFVFFL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H96O27 |
Molecular Weight | 1237.40 g/mol |
Exact Mass | 1236.61389778 g/mol |
Topological Polar Surface Area (TPSA) | 422.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of Primulic acid 2 2D Structure of Primulic acid 2](https://plantaedb.com/storage/docs/compounds/2023/11/primulic-acid-2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.78% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.50% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.81% | 95.93% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.49% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 90.67% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.57% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.91% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.71% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.12% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.01% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.47% | 89.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.43% | 96.38% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.13% | 91.24% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.92% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.94% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.17% | 97.53% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.86% | 97.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.81% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.51% | 92.50% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.03% | 92.98% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.94% | 95.92% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.03% | 94.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.71% | 94.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.66% | 98.10% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.47% | 85.83% |
CHEMBL5028 | O14672 | ADAM10 | 81.45% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.23% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.68% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.53% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.01% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Primula veris |
PubChem | 74095087 |
LOTUS | LTS0146335 |
wikiData | Q105206304 |