Prebetanin
Internal ID | bae1adbd-6c49-4120-bbd5-e553725207b9 |
Taxonomy | Alkaloids and derivatives > Betalains > Betacyanins and derivatives |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(2S)-2-carboxy-1-[(2E)-2-[(2R)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethylidene]-6-hydroxy-2,3-dihydroindol-1-ium-5-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl sulfate |
SMILES (Canonical) | C1C(NC(=CC1=CC=[N+]2C(CC3=CC(=C(C=C32)O)OC4C(C(C(C(O4)COS(=O)(=O)[O-])O)O)O)C(=O)O)C(=O)O)C(=O)O |
SMILES (Isomeric) | C\1[C@@H](NC(=C/C1=C/C=[N+]2[C@@H](CC3=CC(=C(C=C32)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COS(=O)(=O)[O-])O)O)O)C(=O)O)C(=O)O)C(=O)O |
InChI | InChI=1S/C24H26N2O16S/c27-15-7-13-10(6-16(15)41-24-20(30)19(29)18(28)17(42-24)8-40-43(37,38)39)5-14(23(35)36)26(13)2-1-9-3-11(21(31)32)25-12(4-9)22(33)34/h1-3,6-7,12,14,17-20,24,28-30H,4-5,8H2,(H5,27,31,32,33,34,35,36,37,38,39)/t12-,14+,17-,18-,19+,20-,24-/m1/s1 |
InChI Key | OZXPZOHWSFDUDY-RYGANQNKSA-N |
Popularity | 3 references in papers |
Molecular Formula | C24H26N2O16S |
Molecular Weight | 630.50 g/mol |
Exact Mass | 630.10030392 g/mol |
Topological Polar Surface Area (TPSA) | 301.00 Ų |
XlogP | -2.50 |
[(2R,3S,4S,5R,6S)-6-[[(2S)-2-carboxy-1-[(2E)-2-[(2R)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethylidene]-6-hydroxy-2,3-dihydroindol-1-ium-5-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl sulfate |
13798-16-8 |
C08567 |
CHEBI:8367 |
DTXSID20422528 |
Q27108061 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.39% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.40% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.60% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.76% | 95.93% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.50% | 96.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.50% | 92.94% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.08% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.80% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.60% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.33% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.04% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.91% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.91% | 97.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.37% | 97.21% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 86.16% | 85.31% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.49% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 84.91% | 90.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.81% | 98.75% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.65% | 92.32% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.38% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.20% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.02% | 94.80% |
CHEMBL2535 | P11166 | Glucose transporter | 82.54% | 98.75% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.78% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.25% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.07% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beta vulgaris |
Phytolacca americana |
Trifolium pratense |
PubChem | 6325833 |
NPASS | NPC135585 |
LOTUS | LTS0078767 |
wikiData | Q27108061 |