Pratensein 7-O-glucopyranoside
Internal ID | 7745dbdf-e4a2-412e-a783-9d3e2cfaaefc |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 5-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
InChI | InChI=1S/C22H22O11/c1-30-14-3-2-9(4-12(14)24)11-8-31-15-6-10(5-13(25)17(15)18(11)26)32-22-21(29)20(28)19(27)16(7-23)33-22/h2-6,8,16,19-25,27-29H,7H2,1H3/t16-,19-,20+,21-,22-/m1/s1 |
InChI Key | FGAAKLDKKBMYCB-RECXWPGBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.80 |
36191-03-4 |
Pratensein-7-O-beta-D-glucopyranoside |
Pratensein-7-O-|A-D-glucopyranoside |
5-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
DTXSID401297719 |
HY-N7957 |
Pratensein-7-O-??-D-glucopyranoside |
AKOS040760646 |
FS-7220 |
XP161636 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.12% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.48% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.66% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.27% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.36% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.57% | 96.21% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 91.16% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.99% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.53% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.67% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.42% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.19% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.66% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.87% | 95.89% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.11% | 97.28% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.92% | 95.53% |
CHEMBL3194 | P02766 | Transthyretin | 82.90% | 90.71% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.76% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.19% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.79% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ammopiptanthus mongolicus |
Amorpha fruticosa |
Astragalus mongholicus |
Styphnolobium japonicum |
PubChem | 16202157 |
LOTUS | LTS0133789 |
wikiData | Q104994761 |