Praecanson A
| Internal ID | 5dd12bf1-fd34-454f-b1e8-3535641d6c1c |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > Retrochalcones |
| IUPAC Name | (Z)-3-(5,7-dimethoxy-2,2-dimethylchromen-6-yl)-3-methoxy-1-phenylprop-2-en-1-one |
| SMILES (Canonical) | CC1(C=CC2=C(C(=C(C=C2O1)OC)C(=CC(=O)C3=CC=CC=C3)OC)OC)C |
| SMILES (Isomeric) | CC1(C=CC2=C(C(=C(C=C2O1)OC)/C(=C/C(=O)C3=CC=CC=C3)/OC)OC)C |
| InChI | InChI=1S/C23H24O5/c1-23(2)12-11-16-18(28-23)14-20(26-4)21(22(16)27-5)19(25-3)13-17(24)15-9-7-6-8-10-15/h6-14H,1-5H3/b19-13- |
| InChI Key | CDFJITYOZNLONM-UYRXBGFRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 4.30 |
| CHEBI:73782 |
| LMPK12120392 |
| Q27144106 |
| 9,2',6'-trimethoxy-6'',6''-dimethylpyrano-(3',4':2'',3'')-chalcone |
| (2Z)-3-(5,7-dimethoxy-2,2-dimethyl-2H-chromen-6-yl)-3-methoxy-1-phenylprop-2-en-1-one |
| (Z)-3-(5,7-dimethoxy-2,2-dimethylchromen-6-yl)-3-methoxy-1-phenylprop-2-en-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.24% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.15% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.15% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.14% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.01% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.86% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.56% | 99.17% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.06% | 89.44% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.76% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.61% | 91.07% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.94% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.75% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.29% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.03% | 97.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.29% | 94.73% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.13% | 87.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.73% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 82.71% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.20% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.15% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tephrosia praecana |
| Tephrosia pumila |
| PubChem | 9999819 |
| LOTUS | LTS0041299 |
| wikiData | Q27144106 |