Porric acid C
| Internal ID | 0c50a357-7954-4d85-b5fd-36768a57f983 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 2,7-dihydroxy-9-methyldibenzofuran-4-carboxylic acid |
| SMILES (Canonical) | CC1=CC(=CC2=C1C3=C(O2)C(=CC(=C3)O)C(=O)O)O |
| SMILES (Isomeric) | CC1=CC(=CC2=C1C3=C(O2)C(=CC(=C3)O)C(=O)O)O |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(14(17)18)13(9)19-11/h2-5,15-16H,1H3,(H,17,18) |
| InChI Key | XERKTCDLFDGUHP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 90.90 Ų |
| XlogP | 2.80 |
| 207285-04-9 |
| DTXSID301209399 |
| 4-Dibenzofurancarboxylic acid, 2,7-dihydroxy-9-methyl- |
| 4,11-dihydroxy-13-methyl-8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaene-6-carboxylic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.67% | 91.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 94.50% | 87.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.86% | 95.56% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 92.55% | 81.11% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 91.98% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.31% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.05% | 94.73% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 88.67% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.59% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 86.87% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.77% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.65% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.83% | 95.50% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.72% | 83.57% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.60% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.02% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium ampeloprasum |
| Allium obliquum |
| PubChem | 478956 |
| LOTUS | LTS0075029 |
| wikiData | Q104664553 |