Porric acid B
| Internal ID | 1210ebe0-e0d6-4e2e-888d-0a8904782703 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 2,6-dihydroxy-7-methoxy-9-methyldibenzofuran-4-carboxylic acid |
| SMILES (Canonical) | CC1=CC(=C(C2=C1C3=C(O2)C(=CC(=C3)O)C(=O)O)O)OC |
| SMILES (Isomeric) | CC1=CC(=C(C2=C1C3=C(O2)C(=CC(=C3)O)C(=O)O)O)OC |
| InChI | InChI=1S/C15H12O6/c1-6-3-10(20-2)12(17)14-11(6)8-4-7(16)5-9(15(18)19)13(8)21-14/h3-5,16-17H,1-2H3,(H,18,19) |
| InChI Key | YRDAFVVZXCAVIU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 100.00 Ų |
| XlogP | 2.80 |
| 2,6-Dihydroxy-7-methoxy-9-methyl-4-dibenzofurancarboxylic acid |
| CHEBI:174744 |
| DTXSID301176786 |
| 207285-02-7 |
| 2,6-dihydroxy-7-methoxy-9-methyldibenzouran-4-carboxylic acid |
| 4,10-dihydroxy-11-methoxy-13-methyl-8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaene-6-carboxylic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.01% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.03% | 95.56% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.30% | 94.42% |
| CHEMBL3194 | P02766 | Transthyretin | 90.82% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.77% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.84% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.66% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.20% | 99.23% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 87.15% | 95.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.56% | 85.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.08% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.18% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.79% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.29% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.18% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.11% | 97.36% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.13% | 93.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.19% | 90.20% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.91% | 81.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.75% | 99.15% |
| CHEMBL5905 | Q04828 | Aldo-keto reductase family 1 member C1 | 80.15% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium ampeloprasum |
| Allium obliquum |
| PubChem | 478957 |
| LOTUS | LTS0168712 |
| wikiData | Q104664552 |