Porric acid A
| Internal ID | 53144ea5-8079-4a89-9d7f-350b9d64923c |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 6-hydroxy-2,7-dimethoxy-9-methyldibenzofuran-4-carboxylic acid |
| SMILES (Canonical) | CC1=CC(=C(C2=C1C3=C(O2)C(=CC(=C3)OC)C(=O)O)O)OC |
| SMILES (Isomeric) | CC1=CC(=C(C2=C1C3=C(O2)C(=CC(=C3)OC)C(=O)O)O)OC |
| InChI | InChI=1S/C16H14O6/c1-7-4-11(21-3)13(17)15-12(7)9-5-8(20-2)6-10(16(18)19)14(9)22-15/h4-6,17H,1-3H3,(H,18,19) |
| InChI Key | SXRYQQFROYXBDQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 89.10 Ų |
| XlogP | 3.10 |
| CHEBI:174883 |
| DTXSID701177536 |
| 207285-00-5 |
| 6-Hydroxy-2,7-dimethoxy-9-methyl-4-dibenzofurancarboxylic acid |
| 6-hydroxy-2,7-dimethoxy-9-methyldibenzouran-4-carboxylic acid |
| 6-Hydroxy-27-dimethoxy-9-methyl-4-dibenzofurancarboxylic acid |
| 10-hydroxy-4,11-dimethoxy-13-methyl-8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaene-6-carboxylic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.30% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.71% | 85.14% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.69% | 94.42% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.08% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.84% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.28% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.17% | 95.50% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.85% | 97.36% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.63% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.78% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 84.90% | 90.71% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.72% | 81.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.00% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.70% | 98.75% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.48% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.09% | 94.45% |
| CHEMBL5905 | Q04828 | Aldo-keto reductase family 1 member C1 | 82.41% | 91.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.93% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.44% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.27% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium ampeloprasum |
| Allium obliquum |
| PubChem | 478958 |
| LOTUS | LTS0018285 |
| wikiData | Q104664551 |