Porphyroxine
Internal ID | ccccf279-5390-4cf2-a0bb-dafaf4e776a2 |
Taxonomy | Alkaloids and derivatives > Rhoeadine alkaloids |
IUPAC Name | 11,17-dimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaen-16-ol |
SMILES (Canonical) | COC1C2=C(C=CC3=C2OCO3)C4C(O1)C5=CC(=C(C=C5CCN4)OC)O |
SMILES (Isomeric) | COC1C2=C(C=CC3=C2OCO3)C4C(O1)C5=CC(=C(C=C5CCN4)OC)O |
InChI | InChI=1S/C20H21NO6/c1-23-15-7-10-5-6-21-17-11-3-4-14-19(26-9-25-14)16(11)20(24-2)27-18(17)12(10)8-13(15)22/h3-4,7-8,17-18,20-22H,5-6,9H2,1-2H3 |
InChI Key | YLUOVOKBMSLYGX-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H21NO6 |
Molecular Weight | 371.40 g/mol |
Exact Mass | 371.13688739 g/mol |
Topological Polar Surface Area (TPSA) | 78.40 Ų |
XlogP | 1.70 |
(6alpha)-2,8beta-Dimethoxy-10,11-[methylenebis(oxy)]rheadan-3-ol |
18104-24-0 |
YLUOVOKBMSLYGX-UHFFFAOYSA-N |
10,14-Dimethoxy-5b,6,7,8,12b,14-hexahydro[1,3]dioxolo[4',5':7,8]isochromeno[3,4-a][3]benzazepin-11-ol # |
11,17-dimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaen-16-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.42% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.77% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.70% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.90% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.40% | 97.09% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 91.84% | 82.67% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.39% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.24% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.08% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 89.95% | 98.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.58% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.22% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.09% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.05% | 96.77% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.29% | 89.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.22% | 94.73% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 83.11% | 88.48% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.69% | 95.56% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.65% | 91.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.18% | 91.79% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.97% | 96.39% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.74% | 93.40% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Papaver albiflorum |
Papaver atlanticum |
Papaver bracteatum |
Papaver cambricum |
Papaver orientale |
Papaver pinnatifidum |
Papaver rhoeas |
Papaver somniferum subsp. setigerum |
PubChem | 601829 |
LOTUS | LTS0228282 |
wikiData | Q104252469 |