Platydesminium
Internal ID | e30a2c46-c0b9-4d35-b4b1-af65a0704adb |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
IUPAC Name | 2-(4-methoxy-9-methyl-2,3-dihydrofuro[2,3-b]quinolin-9-ium-2-yl)propan-2-ol |
SMILES (Canonical) | CC(C)(C1CC2=C(C3=CC=CC=C3[N+](=C2O1)C)OC)O |
SMILES (Isomeric) | CC(C)(C1CC2=C(C3=CC=CC=C3[N+](=C2O1)C)OC)O |
InChI | InChI=1S/C16H20NO3/c1-16(2,18)13-9-11-14(19-4)10-7-5-6-8-12(10)17(3)15(11)20-13/h5-8,13,18H,9H2,1-4H3/q+1 |
InChI Key | HXSFUGOHWOKESA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H20NO3+ |
Molecular Weight | 274.33 g/mol |
Exact Mass | 274.14431850 g/mol |
Topological Polar Surface Area (TPSA) | 42.60 Ų |
XlogP | 2.60 |
23536-30-3 |
Furo(2,3-b)quinolinium, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-4-methoxy-9-methyl-, (R)- |
CHEBI:174620 |
2-(2-hydroxypropan-2-yl)-4-methoxy-9-methyl-2H,3H-furo[2,3-b]quinolin-9-ium |
2-(4-methoxy-9-methyl-2,3-dihydrouro[2,3-b]quinolin-9-ium-2-yl)propan-2-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.36% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.80% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.12% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 84.09% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.69% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.57% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.48% | 92.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.26% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 81.42% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.03% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.06% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Choisya ternata |
PubChem | 5319758 |
LOTUS | LTS0046935 |
wikiData | Q105035132 |