Piperlotine D
| Internal ID | b0a6f8df-3a99-4e56-85f6-86ba02c0ceee |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
| IUPAC Name | (Z)-1-pyrrolidin-1-yl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)C=CC(=O)N2CCCC2 |
| SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)/C=C\C(=O)N2CCCC2 |
| InChI | InChI=1S/C16H21NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/b7-6- |
| InChI Key | TYFKYDTUEMTUNY-SREVYHEPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 2.20 |
| 958296-13-4 |
| (Z)-1-pyrrolidin-1-yl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| HY-N3048 |
| AKOS040762198 |
| FS-8748 |
| CS-0023093 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.76% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.77% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.14% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.23% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.33% | 85.14% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.36% | 83.57% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.80% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.92% | 89.00% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 82.12% | 94.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.26% | 94.45% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.76% | 89.50% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 80.73% | 92.86% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.15% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.12% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper sarmentosum |
| PubChem | 2288517 |
| LOTUS | LTS0112852 |
| wikiData | Q105267283 |