Piericidin C7
| Internal ID | a0ecb000-ea8b-4613-a9ae-e25721400381 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 2-[(2E,5E,7E,9R,10R)-10-[(2S)-3-[(E)-but-2-en-2-yl]-2-methyloxiran-2-yl]-10-hydroxy-3,7,9-trimethyldeca-2,5,7-trienyl]-5,6-dimethoxy-3-methyl-1H-pyridin-4-one |
| SMILES (Canonical) | CC=C(C)C1C(O1)(C)C(C(C)C=C(C)C=CCC(=CCC2=C(C(=O)C(=C(N2)OC)OC)C)C)O |
| SMILES (Isomeric) | C/C=C(\C)/C1[C@](O1)(C)[C@@H]([C@H](C)/C=C(\C)/C=C/C/C(=C/CC2=C(C(=O)C(=C(N2)OC)OC)C)/C)O |
| InChI | InChI=1S/C28H41NO5/c1-10-19(4)26-28(7,34-26)25(31)20(5)16-18(3)13-11-12-17(2)14-15-22-21(6)23(30)24(32-8)27(29-22)33-9/h10-11,13-14,16,20,25-26,31H,12,15H2,1-9H3,(H,29,30)/b13-11+,17-14+,18-16+,19-10+/t20-,25-,26?,28+/m1/s1 |
| InChI Key | LRGJSNFJKBTWRV-VFZOANNOSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.29847341 g/mol |
| Topological Polar Surface Area (TPSA) | 80.30 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.20% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.27% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.08% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.35% | 94.45% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 93.28% | 91.07% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.70% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.63% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.17% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.16% | 98.75% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 91.89% | 92.98% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.87% | 99.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.09% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.04% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.24% | 83.82% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.24% | 88.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.23% | 90.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.86% | 93.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.15% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.64% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.90% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.45% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.92% | 95.50% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.55% | 89.67% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.10% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Amorpha fruticosa |
| Angelica keiskei |
| PubChem | 139587852 |
| LOTUS | LTS0210462 |
| wikiData | Q105156295 |