Picrasinoside D
Internal ID | f6e99432-0d82-460c-be1c-fce78103a6de |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | [(1S,2S,6S,7S,9R,11S,13S,14R,15S,16S,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-3-oxo-11-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-16-yl] acetate |
SMILES (Canonical) | CC1C=C(C(=O)C2(C1CC3C4(C2C(C(C(C4CC(O3)OC5C(C(C(C(O5)CO)O)O)O)C)OC)OC(=O)C)C)C)OC |
SMILES (Isomeric) | C[C@@H]1C=C(C(=O)[C@]2([C@H]1C[C@@H]3[C@@]4([C@@H]2[C@@H]([C@H]([C@@H]([C@@H]4C[C@@H](O3)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)OC)OC(=O)C)C)C)OC |
InChI | InChI=1S/C30H46O12/c1-12-8-17(37-6)27(36)30(5)15(12)9-19-29(4)16(13(2)24(38-7)25(26(29)30)39-14(3)32)10-20(41-19)42-28-23(35)22(34)21(33)18(11-31)40-28/h8,12-13,15-16,18-26,28,31,33-35H,9-11H2,1-7H3/t12-,13-,15+,16+,18-,19-,20+,21-,22+,23-,24+,25-,26+,28+,29-,30+/m1/s1 |
InChI Key | HEYCCSZPZMLAOR-IKZOBRIXSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H46O12 |
Molecular Weight | 598.70 g/mol |
Exact Mass | 598.29892690 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | 1.40 |
CHEMBL442875 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.60% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.80% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.97% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.63% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.36% | 95.56% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.40% | 81.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.58% | 92.94% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.15% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.57% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.34% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.70% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.52% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.19% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.96% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.36% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picrasma quassioides |
PubChem | 44576018 |
LOTUS | LTS0123182 |
wikiData | Q104397959 |