Picrasinoside A
Internal ID | d56acebb-c123-43d2-8ae1-a4586710babf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | (1S,2S,4S,6R,7S,9R,13R,17S)-15-methoxy-2,6,14,17-tetramethyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-14-ene-3,11,16-trione |
SMILES (Canonical) | CC1CC(C(=O)C2(C1CC3C4(C2C(=O)C(=C(C4CC(=O)O3)C)OC)C)C)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H](C(=O)[C@]2([C@H]1C[C@@H]3[C@@]4([C@@H]2C(=O)C(=C([C@@H]4CC(=O)O3)C)OC)C)C)OC5C(C(C(C(O5)CO)O)O)O |
InChI | InChI=1S/C27H38O11/c1-10-6-14(36-25-20(32)19(31)18(30)15(9-28)37-25)24(34)27(4)12(10)7-16-26(3)13(8-17(29)38-16)11(2)22(35-5)21(33)23(26)27/h10,12-16,18-20,23,25,28,30-32H,6-9H2,1-5H3/t10-,12+,13+,14+,15?,16-,18?,19?,20?,23+,25?,26-,27+/m1/s1 |
InChI Key | WURBSTOWFYGBJO-JTVQRTMTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H38O11 |
Molecular Weight | 538.60 g/mol |
Exact Mass | 538.24141202 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 0.00 |
83543-82-2 |
DTXSID30321058 |
NSC369144 |
NSC-369144 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.38% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.58% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.01% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.73% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.47% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.93% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.82% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.98% | 96.21% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.99% | 96.61% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.50% | 92.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.58% | 96.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.40% | 97.79% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.87% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.92% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.73% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picrasma quassioides |
PubChem | 340011 |
LOTUS | LTS0052230 |
wikiData | Q82078769 |