Picras-2-ene-1,16-dione, 11,12-dihydroxy-2-methoxy-, (11alpha,12beta)-
| Internal ID | 1086ed39-ad01-4b6e-83dc-7b2768946b81 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
| IUPAC Name | 15,16-dihydroxy-4-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione |
| SMILES (Canonical) | CC1C=C(C(=O)C2(C1CC3C4(C2C(C(C(C4CC(=O)O3)C)O)O)C)C)OC |
| SMILES (Isomeric) | CC1C=C(C(=O)C2(C1CC3C4(C2C(C(C(C4CC(=O)O3)C)O)O)C)C)OC |
| InChI | InChI=1S/C21H30O6/c1-9-6-13(26-5)19(25)21(4)11(9)7-14-20(3)12(8-15(22)27-14)10(2)16(23)17(24)18(20)21/h6,9-12,14,16-18,23-24H,7-8H2,1-5H3 |
| InChI Key | ZIVURVYGGHVTQO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.20423867 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 2.00 |
| 24148-76-3 |
| Phenanthro[10,1-bc]pyran-5,11(1H,4H)-dione, 2,3,3a.beta.,6a.beta.,7,7a.alpha.,8,11a,11b.alpha.,11c-decahydro-1.alpha.,2.beta.-dihydroxy-10-methoxy-3.alpha.,8.alpha.,11a.beta.,11c.beta.-tetramethyl- |
| Phenanthro(10,1-bc)pyran-5,11(1H,4H)-dione, 2,3,3a.beta.,6a.beta.,7,7a.alpha.,8,11a,11b.alpha.,11c-decahydro-1.alpha.,2.beta.-dihydroxy-10-methoxy-3.alpha.,8.alpha.,11a.beta.,11c.beta.-tetramethyl- |
| DTXSID90316743 |
| ZIVURVYGGHVTQO-UHFFFAOYSA-N |
| NSC306397 |
| NSC-306397 |
| Picras-2-ene-1,16-dione, 11,12-dihydroxy-2-methoxy-, (11.alpha.,12.beta.)- |
| 11,12-Dihydroxy-2-methoxypicras-2-ene-1,16-dione # |
| Picras-2-ene-1, 11,12-dihydroxy-2-methoxy-, (11.alpha.,12.beta.)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.89% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.88% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.49% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.11% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.64% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.50% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.35% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.34% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.98% | 97.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.91% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.07% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.92% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.73% | 93.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picrasma quassioides |
| Quassia amara |
| PubChem | 328258 |
| LOTUS | LTS0028588 |
| wikiData | Q82070799 |