2-Ethoxy-4-prop-2-enylphenol
| Internal ID | 141037ba-c7ae-4a74-be1b-0cf77ff0f1b9 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | 2-ethoxy-4-prop-2-enylphenol |
| SMILES (Canonical) | CCOC1=C(C=CC(=C1)CC=C)O |
| SMILES (Isomeric) | CCOC1=C(C=CC(=C1)CC=C)O |
| InChI | InChI=1S/C11H14O2/c1-3-5-9-6-7-10(12)11(8-9)13-4-2/h3,6-8,12H,1,4-5H2,2H3 |
| InChI Key | LEXYYUGWWDAGQB-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 2.30 |
| o-ethoxy-p-allylphenol |
| 4-Allyl-2-ethoxyphenol # |
| SCHEMBL4621763 |
| 2-ethoxy-4(2-propenyl)-phenol |
| DTXSID601317878 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.39% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.76% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.50% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.10% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.92% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.11% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.09% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.38% | 94.73% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.65% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.42% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.53% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.94% | 96.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.54% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.54% | 95.56% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 80.10% | 97.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cyperus conglomeratus |
| PubChem | 601250 |
| LOTUS | LTS0127249 |
| wikiData | Q105150878 |