Petunidin 3-O-(6''-acetyl-galactoside)
Internal ID | e9d37749-818c-462c-9b85-9f591dec15bc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-3-O-glycosides |
IUPAC Name | [(2R,3R,4S,5R)-6-[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C(=C4)OC)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C(=C4)OC)O)O)O)O)O)O)O |
InChI | InChI=1S/C24H24O13/c1-9(25)34-8-18-20(30)21(31)22(32)24(37-18)36-17-7-12-13(27)5-11(26)6-15(12)35-23(17)10-3-14(28)19(29)16(4-10)33-2/h3-7,18,20-22,24,30-32H,8H2,1-2H3,(H3-,26,27,28,29)/p+1/t18-,20+,21+,22-,24?/m1/s1 |
InChI Key | GPUBWXUQPURXOQ-SKKXNPCDSA-O |
Popularity | 0 references in papers |
Molecular Formula | C24H25O13+ |
Molecular Weight | 521.40 g/mol |
Exact Mass | 521.12951585 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 0.00 |
DTXSID001341487 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.48% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.82% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.57% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.06% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.04% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.28% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.04% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.40% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.74% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.06% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.55% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.44% | 97.36% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.41% | 99.15% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.81% | 95.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.18% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.05% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.99% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.84% | 92.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.75% | 94.33% |
CHEMBL3194 | P02766 | Transthyretin | 80.24% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vaccinium corymbosum |
PubChem | 157009720 |
LOTUS | LTS0176646 |
wikiData | Q105015188 |