Pericine
Internal ID | 30137d07-07d0-4717-a213-548518aea6aa |
Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
IUPAC Name | (1R,16E)-16-ethylidene-2-methylidene-4,14-diazatetracyclo[12.2.2.03,11.05,10]octadeca-3(11),5,7,9-tetraene |
SMILES (Canonical) | CC=C1CN2CCC1C(=C)C3=C(CC2)C4=CC=CC=C4N3 |
SMILES (Isomeric) | C/C=C\1/CN2CC[C@H]1C(=C)C3=C(CC2)C4=CC=CC=C4N3 |
InChI | InChI=1S/C19H22N2/c1-3-14-12-21-10-8-15(14)13(2)19-17(9-11-21)16-6-4-5-7-18(16)20-19/h3-7,15,20H,2,8-12H2,1H3/b14-3-/t15-/m0/s1 |
InChI Key | VAUGOKMDSLQYNG-WNDJQJCJSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H22N2 |
Molecular Weight | 278.40 g/mol |
Exact Mass | 278.178298710 g/mol |
Topological Polar Surface Area (TPSA) | 19.00 Ų |
XlogP | 3.20 |
84638-28-8 |
56UJL0958V |
(1R,16E)-16-ethylidene-2-methylidene-4,14-diazatetracyclo[12.2.2.03,11.05,10]octadeca-3(11),5,7,9-tetraene |
UNII-56UJL0958V |
SCHEMBL9404439 |
DTXSID101018405 |
2H-3,6-Ethanoazonino(5,4-b)indole, 5-ethylidcene-1,4,5,6,7,8-hexahydro-7-methylene-, (R-(E))- |
Q7168395 |
2H-3,6-ETHANOAZONINO(5,4-B)INDOLE, 5-ETHYLIDENE-1,4,5,6,7,8-HEXAHYDRO-7-METHYLENE-, (5E,6R)- |
2H-3,6-ETHANOAZONINO(5,4-B)INDOLE, 5-ETHYLIDENE-1,4,5,6,7,8-HEXAHYDRO-7-METHYLENE-, (R-(E))- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.31% | 95.56% |
CHEMBL240 | Q12809 | HERG | 95.65% | 89.76% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.96% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 93.08% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.05% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.04% | 96.09% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.45% | 88.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.54% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.12% | 95.89% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 86.09% | 96.42% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.51% | 97.09% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 84.58% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.09% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.29% | 94.45% |
CHEMBL228 | P31645 | Serotonin transporter | 82.25% | 95.51% |
CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 82.15% | 81.14% |
CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 80.12% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia arborea |
PubChem | 6440735 |
LOTUS | LTS0099487 |
wikiData | Q7168395 |