Patuletin 7-galactoside
Internal ID | 2849cb9e-5c6f-4746-9650-f3e9a13d9bf2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-6-methoxy-7-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O[C@H]4C([C@H]([C@H](C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O13/c1-32-21-11(34-22-19(31)17(29)14(26)12(6-23)35-22)5-10-13(16(21)28)15(27)18(30)20(33-10)7-2-3-8(24)9(25)4-7/h2-5,12,14,17,19,22-26,28-31H,6H2,1H3/t12?,14-,17-,19?,22+/m0/s1 |
InChI Key | AFCDXKGLUDDXCK-OGPMXKHPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O13 |
Molecular Weight | 494.40 g/mol |
Exact Mass | 494.10604075 g/mol |
Topological Polar Surface Area (TPSA) | 216.00 Ų |
XlogP | 0.30 |
LMPK12112913 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.80% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.49% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.72% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.23% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.31% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.05% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.19% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.73% | 99.17% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.51% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.59% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.31% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.05% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.85% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.97% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.80% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pallenis spinosa |
PubChem | 44259803 |
LOTUS | LTS0207895 |
wikiData | Q104910962 |