Paclitaxel
| Internal ID | 5cf18857-97c2-4e49-b944-bac679af8a50 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-[(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl]oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES (Canonical) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| SMILES (Isomeric) | CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| InChI | InChI=1S/C47H51NO14/c1-25-31(60-43(56)36(52)35(28-16-10-7-11-17-28)48-41(54)29-18-12-8-13-19-29)23-47(57)40(61-42(55)30-20-14-9-15-21-30)38-45(6,32(51)22-33-46(38,24-58-33)62-27(3)50)39(53)37(59-26(2)49)34(25)44(47,4)5/h7-21,31-33,35-38,40,51-52,57H,22-24H2,1-6H3,(H,48,54)/t31-,32-,33+,35-,36+,37+,38-,40-,45+,46-,47+/m0/s1 |
| InChI Key | RCINICONZNJXQF-MZXODVADSA-N |
| Popularity | 49,992 references in papers |
| Molecular Formula | C47H51NO14 |
| Molecular Weight | 853.90 g/mol |
| Exact Mass | 853.33095530 g/mol |
| Topological Polar Surface Area (TPSA) | 221.00 Ų |
| XlogP | 2.50 |
| Atomic LogP (AlogP) | 3.74 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 10 |
| TAXOL |
| 33069-62-4 |
| Taxol A |
| Yewtaxan |
| Plaxicel |
| Genaxol |
| Genetaxyl |
| Ebetaxel |
| Capxol |
| OncoGel |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9470 | 94.70% |
| Caco-2 | - | 0.9373 | 93.73% |
| Blood Brain Barrier | - | 1.0000 | 100.00% |
| Human oral bioavailability | - | 0.9143 | 91.43% |
| Subcellular localzation | Mitochondria | 0.6557 | 65.57% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | - | 0.7738 | 77.38% |
| OATP1B3 inhibitior | + | 0.9479 | 94.79% |
| MATE1 inhibitior | - | 0.8700 | 87.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9715 | 97.15% |
| P-glycoprotein inhibitior | + | 0.7874 | 78.74% |
| P-glycoprotein substrate | + | 0.9535 | 95.35% |
| CYP3A4 substrate | + | 0.7980 | 79.80% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8698 | 86.98% |
| CYP3A4 inhibition | - | 0.8309 | 83.09% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9045 | 90.45% |
| CYP2C8 inhibition | + | 0.9817 | 98.17% |
| CYP inhibitory promiscuity | - | 0.8937 | 89.37% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.4813 | 48.13% |
| Eye corrosion | - | 0.9872 | 98.72% |
| Eye irritation | - | 0.9100 | 91.00% |
| Skin irritation | - | 0.7657 | 76.57% |
| Skin corrosion | - | 0.9352 | 93.52% |
| Ames mutagenesis | - | 0.9500 | 95.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7442 | 74.42% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.6749 | 67.49% |
| skin sensitisation | - | 0.8230 | 82.30% |
| Respiratory toxicity | + | 0.9333 | 93.33% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | + | 0.6119 | 61.19% |
| Acute Oral Toxicity (c) | III | 0.5918 | 59.18% |
| Estrogen receptor binding | + | 0.8148 | 81.48% |
| Androgen receptor binding | + | 0.8337 | 83.37% |
| Thyroid receptor binding | + | 0.7275 | 72.75% |
| Glucocorticoid receptor binding | + | 0.7632 | 76.32% |
| Aromatase binding | + | 0.6028 | 60.28% |
| PPAR gamma | + | 0.8011 | 80.11% |
| Honey bee toxicity | - | 0.6301 | 63.01% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.9852 | 98.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
17782.8 nM 17782.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
7943.3 nM |
Potency |
via CMAUP
|
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
31622.78 nM |
AC50 |
via CMAUP
|
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
25118.86 nM |
AC50 |
via CMAUP
|
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
1258.9 nM 1258.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL236 | P41143 | Delta opioid receptor |
4202 nM |
IC50 |
via CMAUP
|
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
2511.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293278 | O75496 | Geminin |
22.4 nM 22.4 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 |
34 nM |
IC50 |
via Super-PRED
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
22387.2 nM 44668.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor |
6125 nM |
IC50 |
via CMAUP
|
| CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
562.3 nM 562.3 nM 3548.1 nM |
Potency Potency Potency |
via CMAUP
via Super-PRED via CMAUP |
| CHEMBL1293298 | Q01453 | Peripheral myelin protein 22 |
47.8 nM 47.8 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL1293235 | P02545 | Prelamin-A/C |
1.8 nM 35.5 nM 35.5 nM 63.1 nM 1.8 nM |
Potency Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP via Super-PRED |
| CHEMBL5331 | Q12866 | Proto-oncogene tyrosine-protein kinase MER |
4900 nM |
IC50 |
PMID: 27238842
|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
89.1 nM 89.1 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL1824 | P04626 | Receptor protein-tyrosine kinase erbB-2 |
11108 nM |
IC50 |
via CMAUP
|
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
369 nM 130.9 nM 130.9 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED |
| CHEMBL1697668 | Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 |
280 nM |
IC50 |
PMID: 25618019
|
| CHEMBL1743121 | Q9NPD5 | Solute carrier organic anion transporter family member 1B3 |
260 nM |
IC50 |
PMID: 25618019
|
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
10000 nM |
Potency |
via CMAUP
|
| CHEMBL1293256 | P40225 | Thrombopoietin |
12589.3 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
707.9 nM 707.9 nM |
Potency Potency |
via Super-PRED
via CMAUP |
| CHEMBL2597 | Q13509 | Tubulin beta-3 chain |
7.7 nM 9.2 nM 7.7 nM |
IC50 IC50 IC50 |
PMID: 23895532
PMID: 23332369 via Super-PRED |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN |
23906 nM |
IC50 |
via CMAUP
|
| CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
3981.1 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.80% | 90.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.96% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.07% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.79% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.60% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.55% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.02% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.89% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.60% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.54% | 99.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.47% | 96.47% |
| CHEMBL5028 | O14672 | ADAM10 | 90.35% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.78% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.12% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.80% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.68% | 97.14% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 87.06% | 83.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.68% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.22% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.67% | 97.09% |
| CHEMBL4267 | P37173 | TGF-beta receptor type II | 84.60% | 88.18% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.34% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.78% | 98.75% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.67% | 94.08% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.95% | 92.67% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.83% | 92.98% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.22% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.37% | 90.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 36314 |
| NPASS | NPC208553 |
| ChEMBL | CHEMBL428647 |
| LOTUS | LTS0163460 |
| wikiData | Q423762 |