Oxoberberine
Internal ID | 89a88d38-78ca-42c1-8935-c5a282bf8fd4 |
Taxonomy | Benzenoids > Phenol ethers > Anisoles |
IUPAC Name | 2,3,9,10-tetramethoxy-8H-isoquinolino[3,2-a]isoquinoline |
SMILES (Canonical) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4C=CN3C2)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4C=CN3C2)OC)OC)OC |
InChI | InChI=1S/C21H21NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-11H,12H2,1-4H3 |
InChI Key | YTPWDGSFIHIQPF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H21NO4 |
Molecular Weight | 351.40 g/mol |
Exact Mass | 351.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.80 |
YTPWDGSFIHIQPF-UHFFFAOYSA-N |
2,3,9,10-Tetramethoxy-8H-isoquino[3,2-a]isoquinoline # |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5747 | Q92793 | CREB-binding protein | 98.28% | 95.12% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.97% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 91.30% | 98.75% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.06% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.14% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.28% | 93.40% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.65% | 93.99% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.52% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.33% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.18% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.98% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.73% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.51% | 83.82% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.96% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.80% | 95.56% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.50% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coscinium fenestratum |
PubChem | 631722 |
LOTUS | LTS0096154 |
wikiData | Q104394506 |