Orungal
| Internal ID | 46347c4c-da6c-4a95-a6c1-c8874736ffe9 |
| Taxonomy | Organoheterocyclic compounds > Diazinanes > Piperazines > Phenylpiperazines |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES (Canonical) | CCC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)OCC5COC(O5)(CN6C=NC=N6)C7=C(C=C(C=C7)Cl)Cl |
| SMILES (Isomeric) | CCC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)OC[C@@H]5CO[C@@](O5)(CN6C=NC=N6)C7=C(C=C(C=C7)Cl)Cl |
| InChI | InChI=1S/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m1/s1 |
| InChI Key | VHVPQPYKVGDNFY-AVQIMAJZSA-N |
| Popularity | 6,757 references in papers |
| Molecular Formula | C35H38Cl2N8O4 |
| Molecular Weight | 705.60 g/mol |
| Exact Mass | 704.2393071 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 5.70 |
| Atomic LogP (AlogP) | 5.58 |
| H-Bond Acceptor | 12 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 11 |
| RefChem:792470 |
| 2-butan-2-yl-4-(4-(4-(4-(((2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl)methoxy)phenyl)piperazin-1-yl)phenyl)-1,2,4-triazol-3-one |
| Hyphanox |
| Itraconazol [Spanish] |
| Itraconazolum [Latin] |
| cis-Itraconazole |
| (2S,4R)-Itraconazole (Mixture of Diastereomers) |
| 939027-87-9 |
| Prokanazol |
| Spherazole |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9925 | 99.25% |
| Caco-2 | - | 0.8075 | 80.75% |
| Blood Brain Barrier | + | 0.7250 | 72.50% |
| Human oral bioavailability | + | 0.9143 | 91.43% |
| Subcellular localzation | Mitochondria | 0.4776 | 47.76% |
| OATP2B1 inhibitior | + | 0.6938 | 69.38% |
| OATP1B1 inhibitior | + | 0.8741 | 87.41% |
| OATP1B3 inhibitior | + | 0.9196 | 91.96% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | - | 0.5500 | 55.00% |
| BSEP inhibitior | + | 0.9883 | 98.83% |
| P-glycoprotein inhibitior | + | 0.8284 | 82.84% |
| P-glycoprotein substrate | + | 0.7189 | 71.89% |
| CYP3A4 substrate | + | 0.7980 | 79.80% |
| CYP2C9 substrate | - | 0.7194 | 71.94% |
| CYP2D6 substrate | - | 0.8080 | 80.80% |
| CYP3A4 inhibition | + | 0.5279 | 52.79% |
| CYP2C9 inhibition | + | 0.6180 | 61.80% |
| CYP2C19 inhibition | + | 0.5703 | 57.03% |
| CYP2D6 inhibition | - | 0.8622 | 86.22% |
| CYP1A2 inhibition | - | 0.7666 | 76.66% |
| CYP2C8 inhibition | - | 0.9882 | 98.82% |
| CYP inhibitory promiscuity | + | 0.8219 | 82.19% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7538 | 75.38% |
| Carcinogenicity (trinary) | Non-required | 0.5194 | 51.94% |
| Eye corrosion | - | 0.9886 | 98.86% |
| Eye irritation | - | 0.9307 | 93.07% |
| Skin irritation | - | 0.8147 | 81.47% |
| Skin corrosion | - | 0.9468 | 94.68% |
| Ames mutagenesis | - | 0.5200 | 52.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8619 | 86.19% |
| Micronuclear | + | 0.8700 | 87.00% |
| Hepatotoxicity | + | 0.9321 | 93.21% |
| skin sensitisation | - | 0.8627 | 86.27% |
| Respiratory toxicity | + | 0.9778 | 97.78% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.9750 | 97.50% |
| Nephrotoxicity | - | 0.7870 | 78.70% |
| Acute Oral Toxicity (c) | II | 0.7373 | 73.73% |
| Estrogen receptor binding | + | 0.8906 | 89.06% |
| Androgen receptor binding | + | 0.8446 | 84.46% |
| Thyroid receptor binding | + | 0.6499 | 64.99% |
| Glucocorticoid receptor binding | + | 0.7227 | 72.27% |
| Aromatase binding | - | 0.5855 | 58.55% |
| PPAR gamma | - | 0.8544 | 85.44% |
| Honey bee toxicity | - | 0.8605 | 86.05% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6482 | 64.82% |
| Fish aquatic toxicity | + | 0.9851 | 98.51% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4029 | P25024 | Interleukin-8 receptor A |
100 nM |
IC50 |
via Super-PRED
|
| CHEMBL1790 | P30518 | Vasopressin V2 receptor |
794.33 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 98.03% | 97.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.88% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.43% | 86.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 97.28% | 95.34% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.71% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.34% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.94% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 94.94% | 100.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.72% | 94.80% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 94.71% | 92.68% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.18% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.67% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.40% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.97% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.92% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.48% | 85.14% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.39% | 93.65% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 89.82% | 92.50% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.56% | 98.59% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 89.13% | 97.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.84% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.90% | 92.62% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.45% | 90.24% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.50% | 96.67% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 83.16% | 92.38% |
| CHEMBL3691 | Q13822 | Autotaxin | 83.07% | 96.39% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.86% | 95.78% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.72% | 98.33% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.68% | 95.17% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.01% | 99.18% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.85% | 99.15% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.29% | 96.77% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.25% | 92.86% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.19% | 90.71% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.13% | 86.92% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.90% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sideritis canariensis |
| Sideritis perfoliata subsp. athoa |
| Sideritis soluta |
| PubChem | 6917738 |
| LOTUS | LTS0251506 |
| wikiData | Q104400456 |