oregonoyl B
Internal ID | 5114c3d2-7e4f-4681-b322-837f4a0c8ace |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [(2S,3R,4S,5R)-2-[(3S)-1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptan-3-yl]oxy-4,5-dihydroxyoxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OC2C(C(COC2OC(CCC3=CC(=C(C=C3)O)O)CC(=O)CCC4=CC(=C(C=C4)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)O[C@@H]2[C@H]([C@@H](CO[C@H]2O[C@@H](CCC3=CC(=C(C=C3)O)O)CC(=O)CCC4=CC(=C(C=C4)O)O)O)O)O |
InChI | InChI=1S/C34H38O13/c1-44-30-16-21(6-12-26(30)38)7-13-31(42)47-33-32(43)29(41)18-45-34(33)46-23(9-3-20-5-11-25(37)28(40)15-20)17-22(35)8-2-19-4-10-24(36)27(39)14-19/h4-7,10-16,23,29,32-34,36-41,43H,2-3,8-9,17-18H2,1H3/b13-7+/t23-,29+,32-,33+,34-/m0/s1 |
InChI Key | QEQBTRZSJZAYTN-KRKLTZBFSA-N |
Popularity | 2 references in papers |
Molecular Formula | C34H38O13 |
Molecular Weight | 654.70 g/mol |
Exact Mass | 654.23124126 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 2.80 |
CHEMBL590725 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.83% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.77% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.57% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.07% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.99% | 94.45% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.30% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.04% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.54% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.09% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.29% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.61% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 89.64% | 90.71% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.63% | 85.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.00% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.94% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.23% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.60% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 83.53% | 98.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.09% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.17% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.17% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.07% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.73% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.09% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alnus japonica |
PubChem | 44602674 |
LOTUS | LTS0194585 |
wikiData | Q105219334 |