oregonoyl A
Internal ID | 71f219a5-8c3f-40c1-b0d7-843946c67af0 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [(2S,3R,4S,5R)-2-[(3S)-1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptan-3-yl]oxy-4,5-dihydroxyoxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1C(C(C(C(O1)OC(CCC2=CC(=C(C=C2)O)O)CC(=O)CCC3=CC(=C(C=C3)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H](CCC2=CC(=C(C=C2)O)O)CC(=O)CCC3=CC(=C(C=C3)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)O)O |
InChI | InChI=1S/C33H36O12/c34-22-8-1-19(2-9-22)7-14-30(41)45-32-31(42)29(40)18-43-33(32)44-24(11-4-21-6-13-26(37)28(39)16-21)17-23(35)10-3-20-5-12-25(36)27(38)15-20/h1-2,5-9,12-16,24,29,31-34,36-40,42H,3-4,10-11,17-18H2/b14-7+/t24-,29+,31-,32+,33-/m0/s1 |
InChI Key | QIBTYQFSZFGWCS-YETGDIJESA-N |
Popularity | 2 references in papers |
Molecular Formula | C33H36O12 |
Molecular Weight | 624.60 g/mol |
Exact Mass | 624.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | 2.80 |
CHEMBL590724 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.90% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.48% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.86% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.59% | 98.95% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 93.51% | 85.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.97% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 92.97% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.45% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.02% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.80% | 86.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.56% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.28% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.24% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.56% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.49% | 99.15% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.51% | 95.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.50% | 95.93% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.03% | 95.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.93% | 89.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.36% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.96% | 97.21% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 81.80% | 100.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.13% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alnus japonica |
PubChem | 44602673 |
LOTUS | LTS0128783 |
wikiData | Q105221293 |