Oleifolioside A
| Internal ID | 7b0b12ac-b6f8-4192-832e-b6a3d2f1f19f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | (2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-6-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-14-hydroxy-7,7,12,16-tetramethyl-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(CO8)O)O)O)C)C)O |
| SMILES (Isomeric) | C[C@H](CC[C@@H](C(C)(C)O)O)[C@H]1[C@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2C[C@@H]([C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)O)O[C@@H]7[C@H]([C@@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)C)C)O |
| InChI | InChI=1S/C45H76O17/c1-20(8-9-27(50)41(4,5)56)29-21(46)15-43(7)26-14-25(60-37-33(54)30(51)22(47)16-57-37)36-40(2,3)28(10-11-45(36)19-44(26,45)13-12-42(29,43)6)61-39-35(32(53)24(49)18-59-39)62-38-34(55)31(52)23(48)17-58-38/h20-39,46-56H,8-19H2,1-7H3/t20-,21+,22-,23-,24-,25+,26+,27+,28+,29+,30+,31-,32+,33-,34+,35-,36+,37+,38-,39+,42-,43+,44+,45-/m1/s1 |
| InChI Key | WUQOCGARTQFYMS-VDDOHTIJSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C45H76O17 |
| Molecular Weight | 889.10 g/mol |
| Exact Mass | 888.50825095 g/mol |
| Topological Polar Surface Area (TPSA) | 278.00 Ų |
| XlogP | 0.00 |
| Atomic LogP (AlogP) | -0.33 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 11 |
| 861675-17-4 |
| (2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-6-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-14-hydroxy-7,7,12,16-tetramethyl-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
| oleifoliosides A |
| 3-O-[beta-xylopyranosyl-(1->2)-alpha-arabinopyranosyl]-6-O-beta-xylopyranosyl-3beta,6alpha,16beta,24(S),25-pentahydroxycycloartane |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5739 | 57.39% |
| Caco-2 | - | 0.8818 | 88.18% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.6230 | 62.30% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8504 | 85.04% |
| OATP1B3 inhibitior | + | 0.9158 | 91.58% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | - | 0.5891 | 58.91% |
| P-glycoprotein inhibitior | + | 0.7529 | 75.29% |
| P-glycoprotein substrate | + | 0.5881 | 58.81% |
| CYP3A4 substrate | + | 0.7215 | 72.15% |
| CYP2C9 substrate | - | 0.8019 | 80.19% |
| CYP2D6 substrate | - | 0.8229 | 82.29% |
| CYP3A4 inhibition | - | 0.9615 | 96.15% |
| CYP2C9 inhibition | - | 0.8005 | 80.05% |
| CYP2C19 inhibition | - | 0.8232 | 82.32% |
| CYP2D6 inhibition | - | 0.9519 | 95.19% |
| CYP1A2 inhibition | - | 0.8934 | 89.34% |
| CYP2C8 inhibition | + | 0.6282 | 62.82% |
| CYP inhibitory promiscuity | - | 0.9660 | 96.60% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.6743 | 67.43% |
| Eye corrosion | - | 0.9894 | 98.94% |
| Eye irritation | - | 0.9058 | 90.58% |
| Skin irritation | - | 0.7137 | 71.37% |
| Skin corrosion | - | 0.9466 | 94.66% |
| Ames mutagenesis | - | 0.6278 | 62.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7277 | 72.77% |
| Micronuclear | - | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.6712 | 67.12% |
| skin sensitisation | - | 0.9006 | 90.06% |
| Respiratory toxicity | + | 0.5778 | 57.78% |
| Reproductive toxicity | + | 0.7444 | 74.44% |
| Mitochondrial toxicity | + | 0.5750 | 57.50% |
| Nephrotoxicity | - | 0.8927 | 89.27% |
| Acute Oral Toxicity (c) | I | 0.6013 | 60.13% |
| Estrogen receptor binding | + | 0.7216 | 72.16% |
| Androgen receptor binding | + | 0.7359 | 73.59% |
| Thyroid receptor binding | - | 0.5635 | 56.35% |
| Glucocorticoid receptor binding | + | 0.6173 | 61.73% |
| Aromatase binding | + | 0.6466 | 64.66% |
| PPAR gamma | + | 0.7380 | 73.80% |
| Honey bee toxicity | - | 0.6034 | 60.34% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
| Fish aquatic toxicity | + | 0.8802 | 88.02% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.68% | 97.25% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 98.86% | 95.58% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.74% | 91.11% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 95.69% | 95.69% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.69% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.35% | 97.09% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.32% | 92.88% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.63% | 96.77% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.27% | 95.93% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.08% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.53% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.50% | 97.14% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 89.36% | 95.92% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.20% | 96.47% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.07% | 94.75% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 88.89% | 99.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.81% | 94.45% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 87.41% | 99.17% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.30% | 92.98% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.76% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.59% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.13% | 94.78% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.08% | 91.07% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.89% | 95.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.89% | 90.24% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.46% | 95.17% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.21% | 85.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.83% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.67% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.56% | 82.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.10% | 97.79% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.79% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.73% | 92.62% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.44% | 98.75% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.96% | 96.61% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 81.87% | 92.86% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.62% | 94.62% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.49% | 95.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.36% | 91.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.33% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.07% | 96.38% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.07% | 93.18% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.79% | 98.05% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.77% | 92.86% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.75% | 92.78% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.35% | 97.21% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.00% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus oleifolius |
| PubChem | 101741785 |
| LOTUS | LTS0198936 |
| wikiData | Q105313235 |